summaryrefslogtreecommitdiffstats
path: root/src/kernel/qpainter_x11.cpp
diff options
context:
space:
mode:
authorTimothy Pearson <[email protected]>2011-11-08 12:31:36 -0600
committerTimothy Pearson <[email protected]>2011-11-08 12:31:36 -0600
commitd796c9dd933ab96ec83b9a634feedd5d32e1ba3f (patch)
tree6e3dcca4f77e20ec8966c666aac7c35bd4704053 /src/kernel/qpainter_x11.cpp
downloadtqt3-d796c9dd933ab96ec83b9a634feedd5d32e1ba3f.tar.gz
tqt3-d796c9dd933ab96ec83b9a634feedd5d32e1ba3f.zip
Test conversion to TQt3 from Qt3 8c6fc1f8e35fd264dd01c582ca5e7549b32ab731
Diffstat (limited to 'src/kernel/qpainter_x11.cpp')
-rw-r--r--src/kernel/qpainter_x11.cpp3153
1 files changed, 3153 insertions, 0 deletions
diff --git a/src/kernel/qpainter_x11.cpp b/src/kernel/qpainter_x11.cpp
new file mode 100644
index 000000000..ef80cff3a
--- /dev/null
+++ b/src/kernel/qpainter_x11.cpp
@@ -0,0 +1,3153 @@
+/****************************************************************************
+**
+** Implementation of TQPainter class for X11
+**
+** Created : 940112
+**
+** Copyright (C) 1992-2008 Trolltech ASA. All rights reserved.
+**
+** This file is part of the kernel module of the TQt GUI Toolkit.
+**
+** This file may be used under the terms of the GNU General
+** Public License versions 2.0 or 3.0 as published by the Free
+** Software Foundation and appearing in the files LICENSE.GPL2
+** and LICENSE.GPL3 included in the packaging of this file.
+** Alternatively you may (at your option) use any later version
+** of the GNU General Public License if such license has been
+** publicly approved by Trolltech ASA (or its successors, if any)
+** and the KDE Free TQt Foundation.
+**
+** Please review the following information to ensure GNU General
+** Public Licensing retquirements will be met:
+** http://trolltech.com/products/qt/licenses/licensing/opensource/.
+** If you are unsure which license is appropriate for your use, please
+** review the following information:
+** http://trolltech.com/products/qt/licenses/licensing/licensingoverview
+** or contact the sales department at [email protected].
+**
+** This file may be used under the terms of the Q Public License as
+** defined by Trolltech ASA and appearing in the file LICENSE.TQPL
+** included in the packaging of this file. Licensees holding valid TQt
+** Commercial licenses may use this file in accordance with the TQt
+** Commercial License Agreement provided with the Software.
+**
+** This file is provided "AS IS" with NO WARRANTY OF ANY KIND,
+** INCLUDING THE WARRANTIES OF DESIGN, MERCHANTABILITY AND FITNESS FOR
+** A PARTICULAR PURPOSE. Trolltech reserves all rights not granted
+** herein.
+**
+**********************************************************************/
+
+#include "qplatformdefs.h"
+
+#include "qfont.h"
+#include "qpainter.h"
+#include "qwidget.h"
+#include "qbitmap.h"
+#include "qpixmapcache.h"
+#include "qtextcodec.h"
+#include "qpaintdevicemetrics.h"
+
+#include "qt_x11_p.h"
+
+#include "qtextlayout_p.h"
+#include "qfontdata_p.h"
+#include "qfontengine_p.h"
+#include "qtextengine_p.h"
+
+#include <math.h>
+
+// paintevent magic to provide Windows semantics on X11
+static TQRegion* paintEventClipRegion = 0;
+static TQPaintDevice* paintEventDevice = 0;
+
+void qt_set_paintevent_clipping( TQPaintDevice* dev, const TQRegion& region)
+{
+ if ( !paintEventClipRegion )
+ paintEventClipRegion = new TQRegion( region );
+ else
+ *paintEventClipRegion = region;
+ paintEventDevice = dev;
+}
+
+void qt_clear_paintevent_clipping()
+{
+ delete paintEventClipRegion;
+ paintEventClipRegion = 0;
+ paintEventDevice = 0;
+}
+
+class TQWFlagWidget : public TQWidget
+{
+public:
+ void setWState( WFlags f ) { TQWidget::setWState(f); }
+ void clearWState( WFlags f ) { TQWidget::clearWState(f); }
+ void setWFlags( WFlags f ) { TQWidget::setWFlags(f); }
+ void clearWFlags( WFlags f ) { TQWidget::clearWFlags(f); }
+};
+
+void qt_erase_region( TQWidget* w, const TQRegion& region)
+{
+ TQRegion reg = region;
+
+ if ( TQPainter::redirect(w) || (!w->isTopLevel() && w->backgroundPixmap()
+ && w->backgroundOrigin() != TQWidget::WidgetOrigin) ) {
+ TQPoint offset = w->backgroundOffset();
+ int ox = offset.x();
+ int oy = offset.y();
+
+ bool unclipped = w->testWFlags( TQt::WPaintUnclipped );
+ if ( unclipped )
+ ((TQWFlagWidget*)w)->clearWFlags( TQt::WPaintUnclipped );
+ TQPainter p( w );
+ p.setClipRegion( region ); // automatically includes paintEventDevice if retquired
+ if ( w->backgroundPixmap() )
+ p.drawTiledPixmap( 0, 0, w->width(), w->height(),
+ *w->backgroundPixmap(), ox, oy );
+ else
+ p.fillRect( w->rect(), w->eraseColor() );
+ if ( unclipped )
+ ((TQWFlagWidget*)w)->setWFlags( TQt::WPaintUnclipped );
+ return;
+ }
+
+ if ( w == paintEventDevice && paintEventClipRegion )
+ reg = paintEventClipRegion->intersect( reg );
+
+ TQMemArray<TQRect> r = reg.rects();
+ for (uint i=0; i<r.size(); i++) {
+ const TQRect& rr = r[(int)i];
+ XClearArea( w->x11Display(), w->winId(),
+ rr.x(), rr.y(), rr.width(), rr.height(), False );
+ }
+}
+
+void qt_erase_rect( TQWidget* w, const TQRect& r)
+{
+ if ( TQPainter::redirect(w) || w == paintEventDevice
+ || w->backgroundOrigin() != TQWidget::WidgetOrigin )
+ qt_erase_region( w, r );
+ else
+ XClearArea( w->x11Display(), w->winId(), r.x(), r.y(), r.width(), r.height(), False );
+
+}
+
+#ifdef QT_NO_XFTFREETYPE
+static const TQt::HANDLE rendhd = 0;
+#endif
+
+// hack, so we don't have to make TQRegion::clipRectangles() public or include
+// X11 headers in qregion.h
+inline void *qt_getClipRects( const TQRegion &r, int &num )
+{
+ return r.clipRectangles( num );
+}
+
+static inline void x11SetClipRegion(Display *dpy, GC gc, GC gc2, TQt::HANDLE draw, const TQRegion &r)
+{
+ int num;
+ XRectangle *rects = (XRectangle *)qt_getClipRects( r, num );
+
+ if (gc)
+ XSetClipRectangles( dpy, gc, 0, 0, rects, num, YXBanded );
+ if (gc2)
+ XSetClipRectangles( dpy, gc2, 0, 0, rects, num, YXBanded );
+
+#ifndef QT_NO_XFTFREETYPE
+ if (draw)
+ XftDrawSetClipRectangles((XftDraw *) draw, 0, 0, rects, num);
+#else
+ Q_UNUSED(draw);
+#endif // QT_NO_XFTFREETYPE
+}
+
+static inline void x11ClearClipRegion(Display *dpy, GC gc, GC gc2, TQt::HANDLE draw)
+{
+ if (gc)
+ XSetClipMask(dpy, gc, None);
+ if (gc2)
+ XSetClipMask(dpy, gc2, None);
+
+#ifndef QT_NO_XFTFREETYPE
+ if (draw) {
+# ifdef QT_XFT2
+ XftDrawSetClip((XftDraw *) draw, None);
+# else
+ // stupid Xft1
+ Picture pict = XftDrawPicture((XftDraw *) draw);
+ XRenderPictureAttributes pattr;
+ pattr.clip_mask = None;
+ XRenderChangePicture(dpy, pict, CPClipMask, &pattr);
+# endif // QT_XFT2
+ }
+#else
+ Q_UNUSED(draw);
+#endif // QT_NO_XFTFREETYPE
+}
+
+
+/*****************************************************************************
+ Trigonometric function for TQPainter
+
+ We have implemented simple sine and cosine function that are called from
+ TQPainter::drawPie() and TQPainter::drawChord() when drawing the outline of
+ pies and chords.
+ These functions are slower and less accurate than math.h sin() and cos(),
+ but with still around 1/70000th sec. execution time (on a 486DX2-66) and
+ 8 digits accuracy, it should not be the bottleneck in drawing these shapes.
+ The advantage is that you don't have to link in the math library.
+ *****************************************************************************/
+
+const double Q_PI = 3.14159265358979323846; // pi
+const double Q_2PI = 6.28318530717958647693; // 2*pi
+const double Q_PI2 = 1.57079632679489661923; // pi/2
+
+
+#if defined(Q_CC_GNU) && defined(Q_OS_AIX)
+// AIX 4.2 gcc 2.7.2.3 gets internal error.
+static int qRoundAIX( double d )
+{
+ return qRound(d);
+}
+#define qRound qRoundAIX
+#endif
+
+
+#if defined(Q_CC_GNU) && defined(__i386__)
+
+inline double qcos( double a )
+{
+ double r;
+ __asm__ (
+ "fcos"
+ : "=t" (r) : "0" (a) );
+ return(r);
+}
+
+inline double qsin( double a )
+{
+ double r;
+ __asm__ (
+ "fsin"
+ : "=t" (r) : "0" (a) );
+ return(r);
+}
+
+double qsincos( double a, bool calcCos=FALSE )
+{
+ return calcCos ? qcos(a) : qsin(a);
+}
+
+#else
+
+double qsincos( double a, bool calcCos=FALSE )
+{
+ if ( calcCos ) // calculate cosine
+ a -= Q_PI2;
+ if ( a >= Q_2PI || a <= -Q_2PI ) { // fix range: -2*pi < a < 2*pi
+ int m = (int)(a/Q_2PI);
+ a -= Q_2PI*m;
+ }
+ if ( a < 0.0 ) // 0 <= a < 2*pi
+ a += Q_2PI;
+ int sign = a > Q_PI ? -1 : 1;
+ if ( a >= Q_PI )
+ a = Q_2PI - a;
+ if ( a >= Q_PI2 )
+ a = Q_PI - a;
+ if ( calcCos )
+ sign = -sign;
+ double a2 = a*a; // here: 0 <= a < pi/4
+ double a3 = a2*a; // make taylor sin sum
+ double a5 = a3*a2;
+ double a7 = a5*a2;
+ double a9 = a7*a2;
+ double a11 = a9*a2;
+ return (a-a3/6+a5/120-a7/5040+a9/362880-a11/39916800)*sign;
+}
+
+inline double qsin( double a ) { return qsincos(a, FALSE); }
+inline double qcos( double a ) { return qsincos(a, TRUE); }
+
+#endif
+
+
+/*****************************************************************************
+ TQPainter internal GC (Graphics Context) allocator.
+
+ The GC allocator offers two functions; alloc_gc() and free_gc() that
+ reuse GC objects instead of calling XCreateGC() and XFreeGC(), which
+ are a whole lot slower.
+ *****************************************************************************/
+
+struct TQGC
+{
+ GC gc;
+ char in_use;
+ bool mono;
+ int scrn;
+};
+
+const int gc_array_size = 256;
+static TQGC gc_array[gc_array_size]; // array of GCs
+static bool gc_array_init = FALSE;
+
+
+static void init_gc_array()
+{
+ if ( !gc_array_init ) {
+ memset( gc_array, 0, gc_array_size*sizeof(TQGC) );
+ gc_array_init = TRUE;
+ }
+}
+
+static void cleanup_gc_array( Display *dpy )
+{
+ register TQGC *p = gc_array;
+ int i = gc_array_size;
+ if ( gc_array_init ) {
+ while ( i-- ) {
+ if ( p->gc ) // destroy GC
+ XFreeGC( dpy, p->gc );
+ p++;
+ }
+ gc_array_init = FALSE;
+ }
+}
+
+// #define DONT_USE_GC_ARRAY
+
+static GC alloc_gc( Display *dpy, int scrn, Drawable hd, bool monochrome=FALSE,
+ bool privateGC = FALSE )
+{
+#if defined(DONT_USE_GC_ARRAY)
+ privateGC = TRUE; // will be slower
+#endif
+ if ( privateGC ) {
+ GC gc = XCreateGC( dpy, hd, 0, 0 );
+ XSetGraphicsExposures( dpy, gc, False );
+ return gc;
+ }
+ register TQGC *p = gc_array;
+ int i = gc_array_size;
+ if ( !gc_array_init ) // not initialized
+ init_gc_array();
+ while ( i-- ) {
+ if ( !p->gc ) { // create GC (once)
+ p->gc = XCreateGC( dpy, hd, 0, 0 );
+ p->scrn = scrn;
+ XSetGraphicsExposures( dpy, p->gc, False );
+ p->in_use = FALSE;
+ p->mono = monochrome;
+ }
+ if ( !p->in_use && p->mono == monochrome && p->scrn == scrn ) {
+ p->in_use = TRUE; // available/compatible GC
+ return p->gc;
+ }
+ p++;
+ }
+#if defined(QT_CHECK_NULL)
+ qWarning( "TQPainter: Internal error; no available GC" );
+#endif
+ GC gc = XCreateGC( dpy, hd, 0, 0 );
+ XSetGraphicsExposures( dpy, gc, False );
+ return gc;
+}
+
+static void free_gc( Display *dpy, GC gc, bool privateGC = FALSE )
+{
+#if defined(DONT_USE_GC_ARRAY)
+ privateGC = TRUE; // will be slower
+#endif
+ if ( privateGC ) {
+ Q_ASSERT( dpy != 0 );
+ XFreeGC( dpy, gc );
+ return;
+ }
+ register TQGC *p = gc_array;
+ int i = gc_array_size;
+ if ( gc_array_init ) {
+ while ( i-- ) {
+ if ( p->gc == gc ) {
+ p->in_use = FALSE; // set available
+ XSetClipMask( dpy, gc, None ); // make it reusable
+ XSetFunction( dpy, gc, GXcopy );
+ XSetFillStyle( dpy, gc, FillSolid );
+ XSetTSOrigin( dpy, gc, 0, 0 );
+ return;
+ }
+ p++;
+ }
+ }
+
+ // not found in gc_array
+ XFreeGC(dpy, gc);
+}
+
+
+/*****************************************************************************
+ TQPainter internal GC (Graphics Context) cache for solid pens and
+ brushes.
+
+ The GC cache makes a significant contribution to speeding up
+ drawing. Setting new pen and brush colors will make the painter
+ look for another GC with the same color instead of changing the
+ color value of the GC currently in use. The cache structure is
+ optimized for fast lookup. Only solid line pens with line width 0
+ and solid brushes are cached.
+
+ In addition, stored GCs may have an implicit clipping region
+ set. This prevents any drawing outside paint events. Both
+ updatePen() and updateBrush() keep track of the validity of this
+ clipping region by storing the clip_serial number in the cache.
+
+*****************************************************************************/
+
+struct TQGCC // cached GC
+{
+ GC gc;
+ uint pix;
+ int count;
+ int hits;
+ uint clip_serial;
+ int scrn;
+};
+
+const int gc_cache_size = 29; // multiply by 4
+static TQGCC *gc_cache_buf;
+static TQGCC *gc_cache[4*gc_cache_size];
+static bool gc_cache_init = FALSE;
+static uint gc_cache_clip_serial = 0;
+
+
+static void init_gc_cache()
+{
+ if ( !gc_cache_init ) {
+ gc_cache_init = TRUE;
+ gc_cache_clip_serial = 0;
+ TQGCC *g = gc_cache_buf = new TQGCC[4*gc_cache_size];
+ memset( g, 0, 4*gc_cache_size*sizeof(TQGCC) );
+ for ( int i=0; i<4*gc_cache_size; i++ )
+ gc_cache[i] = g++;
+ }
+}
+
+
+// #define GC_CACHE_STAT
+#if defined(GC_CACHE_STAT)
+#include "qtextstream.h"
+#include "qbuffer.h"
+
+static int g_numhits = 0;
+static int g_numcreates = 0;
+static int g_numfaults = 0;
+#endif
+
+
+static void cleanup_gc_cache()
+{
+ if ( !gc_cache_init )
+ return;
+#if defined(GC_CACHE_STAT)
+ qDebug( "Number of cache hits = %d", g_numhits );
+ qDebug( "Number of cache creates = %d", g_numcreates );
+ qDebug( "Number of cache faults = %d", g_numfaults );
+ for ( int i=0; i<gc_cache_size; i++ ) {
+ TQCString str;
+ TQBuffer buf( str );
+ buf.open(IO_ReadWrite);
+ TQTextStream s(&buf);
+ s << i << ": ";
+ for ( int j=0; j<4; j++ ) {
+ TQGCC *g = gc_cache[i*4+j];
+ s << (g->gc ? 'X' : '-') << ',' << g->hits << ','
+ << g->count << '\t';
+ }
+ s << '\0';
+ qDebug( str );
+ buf.close();
+ }
+#endif
+ delete [] gc_cache_buf;
+ gc_cache_init = FALSE;
+}
+
+
+static bool obtain_gc( void **ref, GC *gc, uint pix, Display *dpy, int scrn,
+ TQt::HANDLE hd, uint painter_clip_serial )
+{
+ if ( !gc_cache_init )
+ init_gc_cache();
+
+ int k = (pix % gc_cache_size) * 4;
+ TQGCC *g = gc_cache[k];
+ TQGCC *prev = 0;
+
+#define NOMATCH (g->gc && (g->pix != pix || g->scrn != scrn || \
+ (g->clip_serial > 0 && g->clip_serial != painter_clip_serial)))
+
+ if ( NOMATCH ) {
+ prev = g;
+ g = gc_cache[++k];
+ if ( NOMATCH ) {
+ prev = g;
+ g = gc_cache[++k];
+ if ( NOMATCH ) {
+ prev = g;
+ g = gc_cache[++k];
+ if ( NOMATCH ) {
+ if ( g->count == 0 && g->scrn == scrn) { // steal this GC
+ g->pix = pix;
+ g->count = 1;
+ g->hits = 1;
+ g->clip_serial = 0;
+ XSetForeground( dpy, g->gc, pix );
+ XSetClipMask(dpy, g->gc, None);
+ gc_cache[k] = prev;
+ gc_cache[k-1] = g;
+ *ref = (void *)g;
+ *gc = g->gc;
+ return TRUE;
+ } else { // all GCs in use
+#if defined(GC_CACHE_STAT)
+ g_numfaults++;
+#endif
+ *ref = 0;
+ return FALSE;
+ }
+ }
+ }
+ }
+ }
+
+#undef NOMATCH
+
+ *ref = (void *)g;
+
+ if ( g->gc ) { // reuse existing GC
+#if defined(GC_CACHE_STAT)
+ g_numhits++;
+#endif
+ *gc = g->gc;
+ g->count++;
+ g->hits++;
+ if ( prev && g->hits > prev->hits ) { // maintain LRU order
+ gc_cache[k] = prev;
+ gc_cache[k-1] = g;
+ }
+ return TRUE;
+ } else { // create new GC
+#if defined(GC_CACHE_STAT)
+ g_numcreates++;
+#endif
+ g->gc = alloc_gc( dpy, scrn, hd, FALSE );
+ g->scrn = scrn;
+ g->pix = pix;
+ g->count = 1;
+ g->hits = 1;
+ g->clip_serial = 0;
+ *gc = g->gc;
+ return FALSE;
+ }
+}
+
+static inline void release_gc( void *ref )
+{
+ ((TQGCC*)ref)->count--;
+}
+
+/*****************************************************************************
+ TQPainter member functions
+ *****************************************************************************/
+
+/*!
+ \internal
+
+ Internal function that initializes the painter.
+*/
+
+void TQPainter::initialize()
+{
+ init_gc_array();
+ init_gc_cache();
+}
+
+/*!
+ \internal
+
+ Internal function that cleans up the painter.
+*/
+
+void TQPainter::cleanup()
+{
+ cleanup_gc_cache();
+ cleanup_gc_array( TQPaintDevice::x11AppDisplay() );
+ TQPointArray::cleanBuffers();
+}
+
+/*!
+ \internal
+
+ Internal function that destroys up the painter.
+*/
+
+void TQPainter::destroy()
+{
+
+}
+
+void TQPainter::init()
+{
+ d = 0;
+ flags = IsStartingUp;
+ bg_col = white; // default background color
+ bg_mode = TransparentMode; // default background mode
+ rop = CopyROP; // default ROP
+ tabstops = 0; // default tabbing
+ tabarray = 0;
+ tabarraylen = 0;
+ ps_stack = 0;
+ wm_stack = 0;
+ gc = gc_brush = 0;
+ pdev = 0;
+ dpy = 0;
+ txop = txinv = 0;
+ penRef = brushRef = 0;
+ clip_serial = 0;
+ pfont = 0;
+ block_ext = FALSE;
+}
+
+
+/*!
+ \fn const TQFont &TQPainter::font() const
+
+ Returns the currently set painter font.
+
+ \sa setFont(), TQFont
+*/
+
+/*!
+ Sets the painter's font to \a font.
+
+ This font is used by subsequent drawText() functions. The text
+ color is the same as the pen color.
+
+ \sa font(), drawText()
+*/
+
+void TQPainter::setFont( const TQFont &font )
+{
+#if defined(QT_CHECK_STATE)
+ if ( !isActive() )
+ qWarning( "TQPainter::setFont: Will be reset by begin()" );
+#endif
+ if ( cfont.d != font.d ) {
+ cfont = font;
+ cfont.x11SetScreen( scrn );
+ setf(DirtyFont);
+ }
+}
+
+
+void TQPainter::updateFont()
+{
+ if (!isActive())
+ return;
+
+ clearf(DirtyFont);
+ if ( testf(ExtDev) ) {
+ if (pdev->devType() == TQInternal::Printer) {
+ if ( pfont ) delete pfont;
+ pfont = new TQFont( cfont.d, pdev );
+ }
+ TQPDevCmdParam param[1];
+ param[0].font = &cfont;
+ if ( !pdev->cmd( TQPaintDevice::PdcSetFont, this, param ) || !hd )
+ return;
+ }
+ setf(NoCache);
+ if ( penRef )
+ updatePen(); // force a non-cached GC
+}
+
+
+void TQPainter::updatePen()
+{
+ if (!isActive())
+ return;
+
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ param[0].pen = &cpen;
+ if ( !pdev->cmd( TQPaintDevice::PdcSetPen, this, param ) || !hd )
+ return;
+ }
+
+ int ps = cpen.style();
+ bool cacheIt = !testf(ClipOn|MonoDev|NoCache) &&
+ (ps == NoPen || ps == SolidLine) &&
+ cpen.width() == 0 && rop == CopyROP;
+
+ bool obtained = FALSE;
+ bool internclipok = hasClipping();
+ if ( cacheIt ) {
+ if ( gc ) {
+ if ( penRef )
+ release_gc( penRef );
+ else
+ free_gc( dpy, gc );
+ }
+ obtained = obtain_gc(&penRef, &gc, cpen.color().pixel(scrn), dpy, scrn,
+ hd, clip_serial);
+ if ( !obtained && !penRef )
+ gc = alloc_gc( dpy, scrn, hd, FALSE );
+ } else {
+ if ( gc ) {
+ if ( penRef ) {
+ release_gc( penRef );
+ penRef = 0;
+ gc = alloc_gc( dpy, scrn, hd, testf(MonoDev) );
+ } else {
+ internclipok = TRUE;
+ }
+ } else {
+ gc = alloc_gc( dpy, scrn, hd, testf(MonoDev), testf(UsePrivateCx) );
+ }
+ }
+
+ if ( !internclipok ) {
+ if ( pdev == paintEventDevice && paintEventClipRegion ) {
+ if ( penRef &&((TQGCC*)penRef)->clip_serial < gc_cache_clip_serial ) {
+ x11SetClipRegion( dpy, gc, 0, rendhd, *paintEventClipRegion );
+ ((TQGCC*)penRef)->clip_serial = gc_cache_clip_serial;
+ } else if ( !penRef ) {
+ x11SetClipRegion( dpy, gc, 0, rendhd, *paintEventClipRegion );
+ }
+ } else if (penRef && ((TQGCC*)penRef)->clip_serial ) {
+ x11ClearClipRegion(dpy, gc, 0, rendhd);
+ ((TQGCC*)penRef)->clip_serial = 0;
+ }
+ }
+
+ if ( obtained )
+ return;
+
+ char dashes[10]; // custom pen dashes
+ int dash_len = 0; // length of dash list
+ int s = LineSolid;
+ int cp = CapButt;
+ int jn = JoinMiter;
+
+ /*
+ We are emulating Windows here. Windows treats cpen.width() == 1
+ (or 0) as a very special case. The fudge variable unifies this
+ case with the general case.
+ */
+ int dot = cpen.width(); // width of a dot
+ int fudge = 1;
+ bool allow_zero_lw = TRUE;
+ if ( dot <= 1 ) {
+ dot = 3;
+ fudge = 2;
+ }
+
+ switch( ps ) {
+ case NoPen:
+ case SolidLine:
+ s = LineSolid;
+ break;
+ case DashLine:
+ dashes[0] = fudge * 3 * dot;
+ dashes[1] = fudge * dot;
+ dash_len = 2;
+ allow_zero_lw = FALSE;
+ break;
+ case DotLine:
+ dashes[0] = dot;
+ dashes[1] = dot;
+ dash_len = 2;
+ allow_zero_lw = FALSE;
+ break;
+ case DashDotLine:
+ dashes[0] = 3 * dot;
+ dashes[1] = fudge * dot;
+ dashes[2] = dot;
+ dashes[3] = fudge * dot;
+ dash_len = 4;
+ allow_zero_lw = FALSE;
+ break;
+ case DashDotDotLine:
+ dashes[0] = 3 * dot;
+ dashes[1] = dot;
+ dashes[2] = dot;
+ dashes[3] = dot;
+ dashes[4] = dot;
+ dashes[5] = dot;
+ dash_len = 6;
+ allow_zero_lw = FALSE;
+ }
+ Q_ASSERT( dash_len <= (int) sizeof(dashes) );
+
+ switch ( cpen.capStyle() ) {
+ case SquareCap:
+ cp = CapProjecting;
+ break;
+ case RoundCap:
+ cp = CapRound;
+ break;
+ case FlatCap:
+ default:
+ cp = CapButt;
+ break;
+ }
+ switch ( cpen.joinStyle() ) {
+ case BevelJoin:
+ jn = JoinBevel;
+ break;
+ case RoundJoin:
+ jn = JoinRound;
+ break;
+ case MiterJoin:
+ default:
+ jn = JoinMiter;
+ break;
+ }
+
+ XSetForeground( dpy, gc, cpen.color().pixel(scrn) );
+ XSetBackground( dpy, gc, bg_col.pixel(scrn) );
+
+ if ( dash_len ) { // make dash list
+ XSetDashes( dpy, gc, 0, dashes, dash_len );
+ s = bg_mode == TransparentMode ? LineOnOffDash : LineDoubleDash;
+ }
+ XSetLineAttributes( dpy, gc,
+ (! allow_zero_lw && cpen.width() == 0) ? 1 : cpen.width(),
+ s, cp, jn );
+}
+
+
+void TQPainter::updateBrush()
+{
+ if (!isActive())
+ return;
+
+ static const uchar dense1_pat[] = { 0xff, 0xbb, 0xff, 0xff, 0xff, 0xbb, 0xff, 0xff };
+ static const uchar dense2_pat[] = { 0x77, 0xff, 0xdd, 0xff, 0x77, 0xff, 0xdd, 0xff };
+ static const uchar dense3_pat[] = { 0x55, 0xbb, 0x55, 0xee, 0x55, 0xbb, 0x55, 0xee };
+ static const uchar dense4_pat[] = { 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa, 0x55, 0xaa };
+ static const uchar dense5_pat[] = { 0xaa, 0x44, 0xaa, 0x11, 0xaa, 0x44, 0xaa, 0x11 };
+ static const uchar dense6_pat[] = { 0x88, 0x00, 0x22, 0x00, 0x88, 0x00, 0x22, 0x00 };
+ static const uchar dense7_pat[] = { 0x00, 0x44, 0x00, 0x00, 0x00, 0x44, 0x00, 0x00 };
+ static const uchar hor_pat[] = { // horizontal pattern
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xff, 0xff, 0xff,
+ 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00,
+ 0x00, 0x00, 0x00, 0xff, 0xff, 0xff, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 };
+ static const uchar ver_pat[] = { // vertical pattern
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20 };
+ static const uchar cross_pat[] = { // cross pattern
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0xff, 0xff, 0xff,
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
+ 0x08, 0x82, 0x20, 0xff, 0xff, 0xff, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0xff, 0xff, 0xff,
+ 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20,
+ 0x08, 0x82, 0x20, 0xff, 0xff, 0xff, 0x08, 0x82, 0x20, 0x08, 0x82, 0x20 };
+ static const uchar bdiag_pat[] = { // backward diagonal pattern
+ 0x20, 0x20, 0x10, 0x10, 0x08, 0x08, 0x04, 0x04, 0x02, 0x02, 0x01, 0x01,
+ 0x80, 0x80, 0x40, 0x40, 0x20, 0x20, 0x10, 0x10, 0x08, 0x08, 0x04, 0x04,
+ 0x02, 0x02, 0x01, 0x01, 0x80, 0x80, 0x40, 0x40 };
+ static const uchar fdiag_pat[] = { // forward diagonal pattern
+ 0x02, 0x02, 0x04, 0x04, 0x08, 0x08, 0x10, 0x10, 0x20, 0x20, 0x40, 0x40,
+ 0x80, 0x80, 0x01, 0x01, 0x02, 0x02, 0x04, 0x04, 0x08, 0x08, 0x10, 0x10,
+ 0x20, 0x20, 0x40, 0x40, 0x80, 0x80, 0x01, 0x01 };
+ static const uchar dcross_pat[] = { // diagonal cross pattern
+ 0x22, 0x22, 0x14, 0x14, 0x08, 0x08, 0x14, 0x14, 0x22, 0x22, 0x41, 0x41,
+ 0x80, 0x80, 0x41, 0x41, 0x22, 0x22, 0x14, 0x14, 0x08, 0x08, 0x14, 0x14,
+ 0x22, 0x22, 0x41, 0x41, 0x80, 0x80, 0x41, 0x41 };
+ static const uchar * const pat_tbl[] = {
+ dense1_pat, dense2_pat, dense3_pat, dense4_pat, dense5_pat,
+ dense6_pat, dense7_pat,
+ hor_pat, ver_pat, cross_pat, bdiag_pat, fdiag_pat, dcross_pat };
+
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ param[0].brush = &cbrush;
+ if ( !pdev->cmd( TQPaintDevice::PdcSetBrush, this, param ) || !hd )
+ return;
+ }
+
+ int bs = cbrush.style();
+ bool cacheIt = !testf(ClipOn|MonoDev|NoCache) &&
+ (bs == NoBrush || bs == SolidPattern) &&
+ bro.x() == 0 && bro.y() == 0 && rop == CopyROP;
+
+ bool obtained = FALSE;
+ bool internclipok = hasClipping();
+ if ( cacheIt ) {
+ if ( gc_brush ) {
+ if ( brushRef )
+ release_gc( brushRef );
+ else
+ free_gc( dpy, gc_brush );
+ }
+ obtained = obtain_gc(&brushRef, &gc_brush, cbrush.color().pixel(scrn), dpy,
+ scrn, hd, clip_serial);
+ if ( !obtained && !brushRef )
+ gc_brush = alloc_gc( dpy, scrn, hd, FALSE );
+ } else {
+ if ( gc_brush ) {
+ if ( brushRef ) {
+ release_gc( brushRef );
+ brushRef = 0;
+ gc_brush = alloc_gc( dpy, scrn, hd, testf(MonoDev) );
+ } else {
+ internclipok = TRUE;
+ }
+ } else {
+ gc_brush = alloc_gc( dpy, scrn, hd, testf(MonoDev), testf(UsePrivateCx));
+ }
+ }
+
+ if ( !internclipok ) {
+ if ( pdev == paintEventDevice && paintEventClipRegion ) {
+ if ( brushRef &&((TQGCC*)brushRef)->clip_serial < gc_cache_clip_serial ) {
+ x11SetClipRegion( dpy, gc_brush, 0, rendhd, *paintEventClipRegion );
+ ((TQGCC*)brushRef)->clip_serial = gc_cache_clip_serial;
+ } else if ( !brushRef ){
+ x11SetClipRegion( dpy, gc_brush, 0, rendhd, *paintEventClipRegion );
+ }
+ } else if (brushRef && ((TQGCC*)brushRef)->clip_serial ) {
+ x11ClearClipRegion(dpy, gc_brush, 0, rendhd);
+ ((TQGCC*)brushRef)->clip_serial = 0;
+ }
+ }
+
+ if ( obtained )
+ return;
+
+ const uchar *pat = 0; // pattern
+ int d = 0; // defalt pattern size: d*d
+ int s = FillSolid;
+ if ( bs >= Dense1Pattern && bs <= DiagCrossPattern ) {
+ pat = pat_tbl[ bs-Dense1Pattern ];
+ if ( bs <= Dense7Pattern )
+ d = 8;
+ else if ( bs <= CrossPattern )
+ d = 24;
+ else
+ d = 16;
+ }
+
+ XSetLineAttributes( dpy, gc_brush, 0, LineSolid, CapButt, JoinMiter );
+ XSetForeground( dpy, gc_brush, cbrush.color().pixel(scrn) );
+ XSetBackground( dpy, gc_brush, bg_col.pixel(scrn) );
+
+ if ( bs == CustomPattern || pat ) {
+ TQPixmap *pm;
+ if ( pat ) {
+ TQString key;
+ key.sprintf( "$qt-brush$%d", bs );
+ pm = TQPixmapCache::find( key );
+ bool del = FALSE;
+ if ( !pm ) { // not already in pm dict
+ pm = new TQBitmap( d, d, pat, TRUE );
+ Q_CHECK_PTR( pm );
+ del = !TQPixmapCache::insert( key, pm );
+ }
+ if ( cbrush.data->pixmap )
+ delete cbrush.data->pixmap;
+ cbrush.data->pixmap = new TQPixmap( *pm );
+ if (del) delete pm;
+ }
+ pm = cbrush.data->pixmap;
+ pm->x11SetScreen( scrn );
+ if ( pm->depth() == 1 ) {
+ XSetStipple( dpy, gc_brush, pm->handle() );
+ s = bg_mode == TransparentMode ? FillStippled : FillOpaqueStippled;
+ } else {
+ XSetTile( dpy, gc_brush, pm->handle() );
+ s = FillTiled;
+ }
+ }
+ XSetFillStyle( dpy, gc_brush, s );
+}
+
+
+/*!
+ Begins painting the paint device \a pd and returns TRUE if
+ successful; otherwise returns FALSE. If \a unclipped is TRUE, the
+ painting will not be clipped at the paint device's boundaries,
+ (although this is not supported by all platforms).
+
+ The errors that can occur are serious problems, such as these:
+
+ \code
+ p->begin( 0 ); // impossible - paint device cannot be 0
+
+ TQPixmap pm( 0, 0 );
+ p->begin( pm ); // impossible - pm.isNull();
+
+ p->begin( myWidget );
+ p2->begin( myWidget ); // impossible - only one painter at a time
+ \endcode
+
+ Note that most of the time, you can use one of the constructors
+ instead of begin(), and that end() is automatically done at
+ destruction.
+
+ \warning A paint device can only be painted by one painter at a
+ time.
+
+ \sa end(), flush()
+*/
+
+bool TQPainter::begin( const TQPaintDevice *pd, bool unclipped )
+{
+ if ( isActive() ) { // already active painting
+#if defined(QT_CHECK_STATE)
+ qWarning( "TQPainter::begin: Painter is already active."
+ "\n\tYou must end() the painter before a second begin()" );
+#endif
+ return FALSE;
+ }
+ if ( pd == 0 ) {
+#if defined(QT_CHECK_NULL)
+ qWarning( "TQPainter::begin: Paint device cannot be null" );
+#endif
+ return FALSE;
+ }
+
+ TQPixmap::x11SetDefaultScreen( pd->x11Screen() );
+
+ const TQWidget *copyFrom = 0;
+ pdev = redirect( (TQPaintDevice*)pd );
+ if ( pdev ) { // redirected paint device?
+ if ( pd->devType() == TQInternal::Widget )
+ copyFrom = (const TQWidget *)pd; // copy widget settings
+ } else {
+ pdev = (TQPaintDevice*)pd;
+ }
+
+ if ( pdev->isExtDev() && pdev->paintingActive() ) {
+ // somebody else is already painting
+#if defined(QT_CHECK_STATE)
+ qWarning( "TQPainter::begin: Another TQPainter is already painting "
+ "this device;\n\tAn extended paint device can only be "
+ "painted by one TQPainter at a time." );
+#endif
+ return FALSE;
+ }
+
+ bool reinit = flags != IsStartingUp; // 2nd or 3rd etc. time called
+ flags = IsActive | DirtyFont; // init flags
+ int dt = pdev->devType(); // get the device type
+
+ if ( (pdev->devFlags & TQInternal::ExternalDevice) != 0 )
+ setf(ExtDev);
+ else if ( dt == TQInternal::Pixmap ) // device is a pixmap
+ ((TQPixmap*)pdev)->detach(); // will modify it
+
+ dpy = pdev->x11Display(); // get display variable
+ scrn = pdev->x11Screen(); // get screen variable
+ hd = pdev->handle(); // get handle to drawable
+ rendhd = pdev->rendhd;
+
+ if ( testf(ExtDev) ) { // external device
+ if ( !pdev->cmd( TQPaintDevice::PdcBegin, this, 0 ) ) {
+ // could not begin painting
+ if ( reinit )
+ clearf( IsActive | DirtyFont );
+ else
+ flags = IsStartingUp;
+ pdev = 0;
+ return FALSE;
+ }
+ if ( tabstops ) // update tabstops for device
+ setTabStops( tabstops );
+ if ( tabarray ) // update tabarray for device
+ setTabArray( tabarray );
+ }
+
+ if ( pdev->x11Depth() != pdev->x11AppDepth( scrn ) ) { // non-standard depth
+ setf(NoCache);
+ setf(UsePrivateCx);
+ }
+
+ pdev->painters++; // also tell paint device
+ bro = curPt = TQPoint( 0, 0 );
+ if ( reinit ) {
+ bg_mode = TransparentMode; // default background mode
+ rop = CopyROP; // default ROP
+ wxmat.reset(); // reset world xform matrix
+ xmat.reset();
+ ixmat.reset();
+ txop = txinv = 0;
+ if ( dt != TQInternal::Widget ) {
+ TQFont defaultFont; // default drawing tools
+ TQPen defaultPen;
+ TQBrush defaultBrush;
+ cfont = defaultFont; // set these drawing tools
+ cpen = defaultPen;
+ cbrush = defaultBrush;
+ bg_col = white; // default background color
+ }
+ }
+ wx = wy = vx = vy = 0; // default view origins
+
+ if ( dt == TQInternal::Widget ) { // device is a widget
+ TQWidget *w = (TQWidget*)pdev;
+ cfont = w->font(); // use widget font
+ cpen = TQPen( w->foregroundColor() ); // use widget fg color
+ if ( reinit ) {
+ TQBrush defaultBrush;
+ cbrush = defaultBrush;
+ }
+ bg_col = w->backgroundColor(); // use widget bg color
+ ww = vw = w->width(); // default view size
+ wh = vh = w->height();
+ if ( unclipped || w->testWFlags( WPaintUnclipped ) ) { // paint direct on device
+ setf( NoCache );
+ setf(UsePrivateCx);
+ updatePen();
+ updateBrush();
+ XSetSubwindowMode( dpy, gc, IncludeInferiors );
+ XSetSubwindowMode( dpy, gc_brush, IncludeInferiors );
+#ifndef QT_NO_XFTFREETYPE
+ if (rendhd)
+ XftDrawSetSubwindowMode((XftDraw *) rendhd, IncludeInferiors);
+#endif
+ }
+ } else if ( dt == TQInternal::Pixmap ) { // device is a pixmap
+ TQPixmap *pm = (TQPixmap*)pdev;
+ if ( pm->isNull() ) {
+#if defined(QT_CHECK_NULL)
+ qWarning( "TQPainter::begin: Cannot paint null pixmap" );
+#endif
+ end();
+ return FALSE;
+ }
+ bool mono = pm->depth() == 1; // monochrome bitmap
+ if ( mono ) {
+ setf( MonoDev );
+ bg_col = color0;
+ cpen.setColor( color1 );
+ }
+ ww = vw = pm->width(); // default view size
+ wh = vh = pm->height();
+ } else if ( testf(ExtDev) ) { // external device
+ ww = vw = pdev->metric( TQPaintDeviceMetrics::PdmWidth );
+ wh = vh = pdev->metric( TQPaintDeviceMetrics::PdmHeight );
+ }
+ if ( ww == 0 )
+ ww = wh = vw = vh = 1024;
+ if ( copyFrom ) { // copy redirected widget
+ cfont = copyFrom->font();
+ cpen = TQPen( copyFrom->foregroundColor() );
+ bg_col = copyFrom->backgroundColor();
+ }
+ if ( testf(ExtDev) ) { // external device
+ setBackgroundColor( bg_col ); // default background color
+ setBackgroundMode( TransparentMode ); // default background mode
+ setRasterOp( CopyROP ); // default raster operation
+ }
+ clip_serial = gc_cache_clip_serial++;
+ updateBrush();
+ updatePen();
+ return TRUE;
+}
+
+/*!
+ Ends painting. Any resources used while painting are released.
+
+ Note that while you mostly don't need to call end(), the
+ destructor will do it, there is at least one common case when it
+ is needed, namely double buffering.
+
+ \code
+ TQPainter p( myPixmap, this )
+ // ...
+ p.end(); // stops drawing on myPixmap
+ p.begin( this );
+ p.drawPixmap( 0, 0, myPixmap );
+ \endcode
+
+ Since you can't draw a TQPixmap while it is being painted, it is
+ necessary to close the active painter.
+
+ \sa begin(), isActive()
+*/
+
+bool TQPainter::end() // end painting
+{
+ if ( !isActive() ) {
+#if defined(QT_CHECK_STATE)
+ qWarning( "TQPainter::end: Missing begin() or begin() failed" );
+#endif
+ return FALSE;
+ }
+ killPStack();
+
+ //#### This should not be necessary:
+ if ( pdev->devType() == TQInternal::Widget && // #####
+ ((TQWidget*)pdev)->testWFlags(WPaintUnclipped) ) {
+ if ( gc )
+ XSetSubwindowMode( dpy, gc, ClipByChildren );
+ if ( gc_brush )
+ XSetSubwindowMode( dpy, gc_brush, ClipByChildren );
+ }
+
+ if ( gc_brush ) { // restore brush gc
+ if ( brushRef ) {
+ release_gc( brushRef );
+ brushRef = 0;
+ } else {
+ free_gc( dpy, gc_brush, testf(UsePrivateCx) );
+ }
+ gc_brush = 0;
+
+ }
+ if ( gc ) { // restore pen gc
+ if ( penRef ) {
+ release_gc( penRef );
+ penRef = 0;
+ } else {
+ free_gc( dpy, gc, testf(UsePrivateCx) );
+ }
+ gc = 0;
+ }
+
+ if ( testf(ExtDev) )
+ pdev->cmd( TQPaintDevice::PdcEnd, this, 0 );
+
+#ifndef QT_NO_XFTFREETYPE
+ if (rendhd) {
+ // reset clipping/subwindow mode on our render picture
+ XftDrawSetClip((XftDraw *) rendhd, None);
+ XftDrawSetSubwindowMode((XftDraw *) rendhd, ClipByChildren);
+ }
+#endif // QT_NO_XFTFREETYPE
+
+ if ( pfont ) {
+ delete pfont;
+ pfont = 0;
+ }
+
+ flags = 0;
+ pdev->painters--;
+ pdev = 0;
+ dpy = 0;
+ return TRUE;
+}
+
+/*!
+ Flushes any buffered drawing operations inside the region \a
+ region using clipping mode \a cm.
+
+ The flush may update the whole device if the platform does not
+ support flushing to a specified region.
+
+ \sa flush() CoordinateMode
+*/
+
+void TQPainter::flush(const TQRegion &, CoordinateMode)
+{
+ flush();
+}
+
+
+/*!
+ \overload
+
+ Flushes any buffered drawing operations.
+*/
+
+void TQPainter::flush()
+{
+ if ( isActive() && dpy )
+ XFlush( dpy );
+}
+
+
+/*!
+ Sets the background color of the painter to \a c.
+
+ The background color is the color that is filled in when drawing
+ opaque text, stippled lines and bitmaps. The background color has
+ no effect in transparent background mode (which is the default).
+
+ \sa backgroundColor() setBackgroundMode() BackgroundMode
+*/
+
+void TQPainter::setBackgroundColor( const TQColor &c )
+{
+ if ( !isActive() ) {
+#if defined(QT_CHECK_STATE)
+ qWarning( "TQPainter::setBackgroundColor: Call begin() first" );
+#endif
+ return;
+ }
+ bg_col = c;
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ param[0].color = &bg_col;
+ if ( !pdev->cmd( TQPaintDevice::PdcSetBkColor, this, param ) || !hd )
+ return;
+ }
+ if ( !penRef )
+ updatePen(); // update pen setting
+ if ( !brushRef )
+ updateBrush(); // update brush setting
+}
+
+/*!
+ Sets the background mode of the painter to \a m, which must be
+ either \c TransparentMode (the default) or \c OpaqueMode.
+
+ Transparent mode draws stippled lines and text without setting the
+ background pixels. Opaque mode fills these space with the current
+ background color.
+
+ Note that in order to draw a bitmap or pixmap transparently, you
+ must use TQPixmap::setMask().
+
+ \sa backgroundMode(), setBackgroundColor()
+*/
+
+void TQPainter::setBackgroundMode( BGMode m )
+{
+ if ( !isActive() ) {
+#if defined(QT_CHECK_STATE)
+ qWarning( "TQPainter::setBackgroundMode: Call begin() first" );
+#endif
+ return;
+ }
+ if ( m != TransparentMode && m != OpaqueMode ) {
+#if defined(QT_CHECK_RANGE)
+ qWarning( "TQPainter::setBackgroundMode: Invalid mode" );
+#endif
+ return;
+ }
+ bg_mode = m;
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ param[0].ival = m;
+ if ( !pdev->cmd( TQPaintDevice::PdcSetBkMode, this, param ) || !hd )
+ return;
+ }
+ if ( !penRef )
+ updatePen(); // update pen setting
+ if ( !brushRef )
+ updateBrush(); // update brush setting
+}
+
+static const short ropCodes[] = { // ROP translation table
+ GXcopy, // CopyROP
+ GXor, // OrROP
+ GXxor, // XorROP
+ GXandInverted, // NotAndROP EraseROP
+ GXcopyInverted, // NotCopyROP
+ GXorInverted, // NotOrROP
+ GXequiv, // NotXorROP
+ GXand, // AndROP
+ GXinvert, // NotROP
+ GXclear, // ClearROP
+ GXset, // SetROP
+ GXnoop, // NopROP
+ GXandReverse, // AndNotROP
+ GXorReverse, // OrNotROP
+ GXnand, // NandROP
+ GXnor // NorROP
+};
+
+
+/*!
+ Sets the \link TQt::RasterOp raster operation \endlink to \a r.
+ The default is \c CopyROP.
+
+ \sa rasterOp() TQt::RasterOp
+*/
+
+void TQPainter::setRasterOp( RasterOp r )
+{
+ if ( !isActive() ) {
+#if defined(QT_CHECK_STATE)
+ qWarning( "TQPainter::setRasterOp: Call begin() first" );
+#endif
+ return;
+ }
+ if ( (uint)r > LastROP ) {
+#if defined(QT_CHECK_RANGE)
+ qWarning( "TQPainter::setRasterOp: Invalid ROP code" );
+#endif
+ return;
+ }
+ rop = r;
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ param[0].ival = r;
+ if ( !pdev->cmd( TQPaintDevice::PdcSetROP, this, param ) || !hd )
+ return;
+ }
+ if ( penRef )
+ updatePen(); // get non-cached pen GC
+ if ( brushRef )
+ updateBrush(); // get non-cached brush GC
+ XSetFunction( dpy, gc, ropCodes[rop] );
+ XSetFunction( dpy, gc_brush, ropCodes[rop] );
+}
+
+// ### matthias - true?
+
+/*!
+ Sets the brush origin to \a (x, y).
+
+ The brush origin specifies the (0, 0) coordinate of the painter's
+ brush. This setting only applies to pattern brushes and pixmap
+ brushes.
+
+ \sa brushOrigin()
+*/
+
+void TQPainter::setBrushOrigin( int x, int y )
+{
+ if ( !isActive() ) {
+#if defined(QT_CHECK_STATE)
+ qWarning( "TQPainter::setBrushOrigin: Call begin() first" );
+#endif
+ return;
+ }
+ bro = TQPoint(x, y);
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ param[0].point = &bro;
+ if ( !pdev->cmd( TQPaintDevice::PdcSetBrushOrigin, this, param ) ||
+ !hd )
+ return;
+ }
+ if ( brushRef )
+ updateBrush(); // get non-cached brush GC
+ XSetTSOrigin( dpy, gc_brush, x, y );
+}
+
+
+/*!
+ Enables clipping if \a enable is TRUE, or disables clipping if \a
+ enable is FALSE.
+
+ \sa hasClipping(), setClipRect(), setClipRegion()
+*/
+
+void TQPainter::setClipping( bool enable )
+{
+ if ( !isActive() ) {
+#if defined(QT_CHECK_STATE)
+ qWarning( "TQPainter::setClipping: Will be reset by begin()" );
+#endif
+ return;
+ }
+
+ if ( enable == testf(ClipOn) )
+ return;
+
+ setf( ClipOn, enable );
+ if ( testf(ExtDev) ) {
+ if ( block_ext )
+ return;
+ TQPDevCmdParam param[1];
+ param[0].ival = enable;
+ if ( !pdev->cmd( TQPaintDevice::PdcSetClip, this, param ) || !hd )
+ return;
+ }
+ if ( enable ) {
+ TQRegion rgn = crgn;
+ if ( pdev == paintEventDevice && paintEventClipRegion )
+ rgn = rgn.intersect( *paintEventClipRegion );
+ if ( penRef )
+ updatePen();
+ if ( brushRef )
+ updateBrush();
+ x11SetClipRegion( dpy, gc, gc_brush, rendhd, rgn );
+ } else {
+ if ( pdev == paintEventDevice && paintEventClipRegion ) {
+ x11SetClipRegion( dpy, gc, gc_brush , rendhd, *paintEventClipRegion );
+ } else {
+ x11ClearClipRegion(dpy, gc, gc_brush, rendhd);
+ }
+ }
+}
+
+
+/*!
+ \overload
+
+ Sets the clip region to the rectangle \a r and enables clipping.
+ The clip mode is set to \a m.
+
+ \sa CoordinateMode
+*/
+
+void TQPainter::setClipRect( const TQRect &r, CoordinateMode m )
+{
+ setClipRegion( TQRegion( r ), m );
+}
+
+/*!
+ Sets the clip region to \a rgn and enables clipping. The clip mode
+ is set to \a m.
+
+ Note that the clip region is given in physical device coordinates
+ and \e not subject to any \link coordsys.html coordinate
+ transformation.\endlink
+
+ \sa setClipRect(), clipRegion(), setClipping() CoordinateMode
+*/
+
+void TQPainter::setClipRegion( const TQRegion &rgn, CoordinateMode m )
+{
+#if defined(QT_CHECK_STATE)
+ if ( !isActive() )
+ qWarning( "TQPainter::setClipRegion: Will be reset by begin()" );
+#endif
+ if ( m == CoordDevice )
+ crgn = rgn;
+ else
+ crgn = xmat * rgn;
+
+ if ( testf(ExtDev) ) {
+ if ( block_ext )
+ return;
+ TQPDevCmdParam param[2];
+ param[0].rgn = &rgn;
+ param[1].ival = m;
+ if ( !pdev->cmd( TQPaintDevice::PdcSetClipRegion, this, param ) )
+ return; // device cannot clip
+ }
+ clearf( ClipOn ); // be sure to update clip rgn
+ setClipping( TRUE );
+}
+
+
+/*!
+ \internal
+
+ Internal function for drawing a polygon.
+*/
+
+void TQPainter::drawPolyInternal( const TQPointArray &a, bool close )
+{
+ if ( a.size() < 2 )
+ return;
+
+ int x1, y1, x2, y2; // connect last to first point
+ a.point( a.size()-1, &x1, &y1 );
+ a.point( 0, &x2, &y2 );
+ bool do_close = close && !(x1 == x2 && y1 == y2);
+
+ if ( close && cbrush.style() != NoBrush ) { // draw filled polygon
+ XFillPolygon( dpy, hd, gc_brush, (XPoint*)a.shortPoints(), a.size(),
+ Nonconvex, CoordModeOrigin );
+ if ( cpen.style() == NoPen ) { // draw fake outline
+ XDrawLines( dpy, hd, gc_brush, (XPoint*)a.shortPoints(), a.size(),
+ CoordModeOrigin );
+ if ( do_close )
+ XDrawLine( dpy, hd, gc_brush, x1, y1, x2, y2 );
+ }
+ }
+ if ( cpen.style() != NoPen ) { // draw outline
+ XDrawLines( dpy, hd, gc, (XPoint*)a.shortPoints(), a.size(),
+ CoordModeOrigin);
+ if ( do_close )
+ XDrawLine( dpy, hd, gc, x1, y1, x2, y2 );
+ }
+}
+
+
+/*!
+ Draws/plots a single point at \a (x, y) using the current pen.
+
+ \sa TQPen
+*/
+
+void TQPainter::drawPoint( int x, int y )
+{
+ if ( !isActive() )
+ return;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ TQPoint p( x, y );
+ param[0].point = &p;
+ if ( !pdev->cmd( TQPaintDevice::PdcDrawPoint, this, param ) ||
+ !hd )
+ return;
+ }
+ map( x, y, &x, &y );
+ }
+ if ( cpen.style() != NoPen )
+ XDrawPoint( dpy, hd, gc, x, y );
+}
+
+
+/*!
+ Draws/plots an array of points, \a a, using the current pen.
+
+ If \a index is non-zero (the default is zero) only points from \a
+ index are drawn. If \a npoints is negative (the default) the rest
+ of the points from \a index are drawn. If \a npoints is zero or
+ greater, \a npoints points are drawn.
+
+ \warning On X11, coordinates that do not fit into 16-bit signed
+ values are truncated. This limitation is expected to go away in
+ TQt 4.
+*/
+
+void TQPainter::drawPoints( const TQPointArray& a, int index, int npoints )
+{
+ if ( npoints < 0 )
+ npoints = a.size() - index;
+ if ( index + npoints > (int)a.size() )
+ npoints = a.size() - index;
+ if ( !isActive() || npoints < 1 || index < 0 )
+ return;
+ TQPointArray pa = a;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ for (int i=0; i<npoints; i++) {
+ TQPoint p( pa[index+i].x(), pa[index+i].y() );
+ param[0].point = &p;
+ if ( !pdev->cmd( TQPaintDevice::PdcDrawPoint, this, param ))
+ return;
+ }
+ if ( !hd ) return;
+ }
+ if ( txop != TxNone ) {
+ pa = xForm( a, index, npoints );
+ if ( pa.size() != a.size() ) {
+ index = 0;
+ npoints = pa.size();
+ }
+ }
+ }
+ if ( cpen.style() != NoPen )
+ XDrawPoints( dpy, hd, gc, (XPoint*)(pa.shortPoints( index, npoints )),
+ npoints, CoordModeOrigin );
+}
+
+
+/*! \obsolete
+ Sets the current pen position to \a (x, y)
+
+ \sa lineTo(), pos()
+*/
+
+void TQPainter::moveTo( int x, int y )
+{
+ if ( !isActive() )
+ return;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ TQPoint p( x, y );
+ param[0].point = &p;
+ if ( !pdev->cmd( TQPaintDevice::PdcMoveTo, this, param ) || !hd )
+ return;
+ }
+ }
+ curPt = TQPoint( x, y );
+}
+
+/*! \obsolete
+ Use drawLine() instead.
+
+ Draws a line from the current pen position to \a (x, y) and sets
+ \a (x, y) to be the new current pen position.
+
+ \sa TQPen moveTo(), drawLine(), pos()
+*/
+
+void TQPainter::lineTo( int x, int y )
+{
+ if ( !isActive() )
+ return;
+ int cx = curPt.x(), cy = curPt.y();
+ curPt = TQPoint( x, y );
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ TQPoint p( x, y );
+ param[0].point = &p;
+ if ( !pdev->cmd( TQPaintDevice::PdcLineTo, this, param ) || !hd )
+ return;
+ }
+ map( x, y, &x, &y );
+ map( cx, cy, &cx, &cy );
+ }
+ if ( cpen.style() != NoPen )
+ XDrawLine( dpy, hd, gc, cx, cy, x, y );
+}
+
+/*!
+ Draws a line from (\a x1, \a y1) to (\a x2, \a y2) and sets the
+ current pen position to (\a x2, \a y2).
+
+ \sa pen()
+*/
+
+void TQPainter::drawLine( int x1, int y1, int x2, int y2 )
+{
+ if ( !isActive() )
+ return;
+ curPt = TQPoint( x2, y2 );
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[2];
+ TQPoint p1(x1, y1), p2(x2, y2);
+ param[0].point = &p1;
+ param[1].point = &p2;
+ if ( !pdev->cmd( TQPaintDevice::PdcDrawLine, this, param ) || !hd )
+ return;
+ }
+ map( x1, y1, &x1, &y1 );
+ map( x2, y2, &x2, &y2 );
+ }
+ if ( cpen.style() != NoPen )
+ XDrawLine( dpy, hd, gc, x1, y1, x2, y2 );
+}
+
+
+
+/*!
+ Draws a rectangle with upper left corner at \a (x, y) and with
+ width \a w and height \a h.
+
+ \sa TQPen, drawRoundRect()
+*/
+
+void TQPainter::drawRect( int x, int y, int w, int h )
+{
+ if ( !isActive() )
+ return;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ TQRect r( x, y, w, h );
+ param[0].rect = &r;
+ if ( !pdev->cmd( TQPaintDevice::PdcDrawRect, this, param ) || !hd )
+ return;
+ }
+ if ( txop == TxRotShear ) { // rotate/shear polygon
+ TQPointArray pa = xmat.mapToPolygon( TQRect(x, y, w, h) );
+ pa.resize( 5 );
+ pa.setPoint( 4, pa.point( 0 ) );
+ drawPolyInternal( pa );
+ return;
+ }
+ map( x, y, w, h, &x, &y, &w, &h );
+ }
+ if ( w <= 0 || h <= 0 ) {
+ if ( w == 0 || h == 0 )
+ return;
+ fix_neg_rect( &x, &y, &w, &h );
+ }
+ if ( cbrush.style() != NoBrush ) {
+ if ( cpen.style() == NoPen ) {
+ XFillRectangle( dpy, hd, gc_brush, x, y, w, h );
+ return;
+ }
+ int lw = cpen.width();
+ int lw2 = (lw+1)/2;
+ if ( w > lw && h > lw )
+ XFillRectangle( dpy, hd, gc_brush, x+lw2, y+lw2, w-lw-1, h-lw-1 );
+ }
+ if ( cpen.style() != NoPen )
+ XDrawRectangle( dpy, hd, gc, x, y, w-1, h-1 );
+}
+
+/*!
+ \overload
+
+ Draws a Windows focus rectangle with upper left corner at (\a x,
+ \a y) and with width \a w and height \a h.
+
+ This function draws a stippled XOR rectangle that is used to
+ indicate keyboard focus (when TQApplication::style() is \c
+ WindowStyle).
+
+ \warning This function draws nothing if the coordinate system has
+ been \link rotate() rotated\endlink or \link shear()
+ sheared\endlink.
+
+ \sa drawRect(), TQApplication::style()
+*/
+
+void TQPainter::drawWinFocusRect( int x, int y, int w, int h )
+{
+ drawWinFocusRect( x, y, w, h, TRUE, color0 );
+}
+
+/*!
+ Draws a Windows focus rectangle with upper left corner at (\a x,
+ \a y) and with width \a w and height \a h using a pen color that
+ contrasts with \a bgColor.
+
+ This function draws a stippled rectangle (XOR is not used) that is
+ used to indicate keyboard focus (when the TQApplication::style() is
+ \c WindowStyle).
+
+ The pen color used to draw the rectangle is either white or black
+ depending on the color of \a bgColor (see TQColor::gray()).
+
+ \warning This function draws nothing if the coordinate system has
+ been \link rotate() rotated\endlink or \link shear()
+ sheared\endlink.
+
+ \sa drawRect(), TQApplication::style()
+*/
+
+void TQPainter::drawWinFocusRect( int x, int y, int w, int h,
+ const TQColor &bgColor )
+{
+ drawWinFocusRect( x, y, w, h, FALSE, bgColor );
+}
+
+
+/*!
+ \internal
+*/
+
+void TQPainter::drawWinFocusRect( int x, int y, int w, int h,
+ bool xorPaint, const TQColor &bgColor )
+{
+ if ( !isActive() || txop == TxRotShear )
+ return;
+ static char winfocus_line[] = { 1, 1 };
+
+ TQPen old_pen = cpen;
+ RasterOp old_rop = (RasterOp)rop;
+
+ if ( xorPaint ) {
+ if ( TQColor::numBitPlanes() <= 8 )
+ setPen( color1 );
+ else
+ setPen( white );
+ setRasterOp( XorROP );
+ } else {
+ if ( qGray( bgColor.rgb() ) < 128 )
+ setPen( white );
+ else
+ setPen( black );
+ }
+
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ TQRect r( x, y, w, h );
+ param[0].rect = &r;
+ if ( !pdev->cmd( TQPaintDevice::PdcDrawRect, this, param ) || !hd) {
+ setRasterOp( old_rop );
+ setPen( old_pen );
+ return;
+ }
+ }
+ map( x, y, w, h, &x, &y, &w, &h );
+ }
+ if ( w <= 0 || h <= 0 ) {
+ if ( w == 0 || h == 0 )
+ return;
+ fix_neg_rect( &x, &y, &w, &h );
+ }
+ XSetDashes( dpy, gc, 0, winfocus_line, 2 );
+ XSetLineAttributes( dpy, gc, 1, LineOnOffDash, CapButt, JoinMiter );
+
+ XDrawRectangle( dpy, hd, gc, x, y, w-1, h-1 );
+ XSetLineAttributes( dpy, gc, 0, LineSolid, CapButt, JoinMiter );
+ setRasterOp( old_rop );
+ setPen( old_pen );
+}
+
+
+/*!
+ Draws a rectangle with rounded corners at \a (x, y), with width \a
+ w and height \a h.
+
+ The \a xRnd and \a yRnd arguments specify how rounded the corners
+ should be. 0 is angled corners, 99 is maximum roundedness.
+
+ The width and height include all of the drawn lines.
+
+ \sa drawRect(), TQPen
+*/
+
+void TQPainter::drawRoundRect( int x, int y, int w, int h, int xRnd, int yRnd )
+{
+ if ( !isActive() )
+ return;
+ if ( xRnd <= 0 || yRnd <= 0 ) {
+ drawRect( x, y, w, h ); // draw normal rectangle
+ return;
+ }
+ if ( xRnd >= 100 ) // fix ranges
+ xRnd = 99;
+ if ( yRnd >= 100 )
+ yRnd = 99;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[3];
+ TQRect r( x, y, w, h );
+ param[0].rect = &r;
+ param[1].ival = xRnd;
+ param[2].ival = yRnd;
+ if ( !pdev->cmd( TQPaintDevice::PdcDrawRoundRect, this, param ) ||
+ !hd )
+ return;
+ }
+ if ( txop == TxRotShear ) { // rotate/shear polygon
+ if ( w <= 0 || h <= 0 )
+ fix_neg_rect( &x, &y, &w, &h );
+ w--;
+ h--;
+ int rxx = w*xRnd/200;
+ int ryy = h*yRnd/200;
+ // were there overflows?
+ if ( rxx < 0 )
+ rxx = w/200*xRnd;
+ if ( ryy < 0 )
+ ryy = h/200*yRnd;
+ int rxx2 = 2*rxx;
+ int ryy2 = 2*ryy;
+ TQPointArray a[4];
+ a[0].makeArc( x, y, rxx2, ryy2, 1*16*90, 16*90, xmat );
+ a[1].makeArc( x, y+h-ryy2, rxx2, ryy2, 2*16*90, 16*90, xmat );
+ a[2].makeArc( x+w-rxx2, y+h-ryy2, rxx2, ryy2, 3*16*90, 16*90, xmat );
+ a[3].makeArc( x+w-rxx2, y, rxx2, ryy2, 0*16*90, 16*90, xmat );
+ // ### is there a better way to join TQPointArrays?
+ TQPointArray aa;
+ aa.resize( a[0].size() + a[1].size() + a[2].size() + a[3].size() );
+ uint j = 0;
+ for ( int k=0; k<4; k++ ) {
+ for ( uint i=0; i<a[k].size(); i++ ) {
+ aa.setPoint( j, a[k].point(i) );
+ j++;
+ }
+ }
+ drawPolyInternal( aa );
+ return;
+ }
+ map( x, y, w, h, &x, &y, &w, &h );
+ }
+ w--;
+ h--;
+ if ( w <= 0 || h <= 0 ) {
+ if ( w == 0 || h == 0 )
+ return;
+ fix_neg_rect( &x, &y, &w, &h );
+ }
+ int rx = (w*xRnd)/200;
+ int ry = (h*yRnd)/200;
+ int rx2 = 2*rx;
+ int ry2 = 2*ry;
+ if ( cbrush.style() != NoBrush ) { // draw filled round rect
+ int dp, ds;
+ if ( cpen.style() == NoPen ) {
+ dp = 0;
+ ds = 1;
+ }
+ else {
+ dp = 1;
+ ds = 0;
+ }
+#define SET_ARC(px, py, w, h, a1, a2) \
+ a->x=px; a->y=py; a->width=w; a->height=h; a->angle1=a1; a->angle2=a2; a++
+ XArc arcs[4];
+ XArc *a = arcs;
+ SET_ARC( x+w-rx2, y, rx2, ry2, 0, 90*64 );
+ SET_ARC( x, y, rx2, ry2, 90*64, 90*64 );
+ SET_ARC( x, y+h-ry2, rx2, ry2, 180*64, 90*64 );
+ SET_ARC( x+w-rx2, y+h-ry2, rx2, ry2, 270*64, 90*64 );
+ XFillArcs( dpy, hd, gc_brush, arcs, 4 );
+#undef SET_ARC
+#define SET_RCT(px, py, w, h) \
+ r->x=px; r->y=py; r->width=w; r->height=h; r++
+ XRectangle rects[3];
+ XRectangle *r = rects;
+ SET_RCT( x+rx, y+dp, w-rx2, ry );
+ SET_RCT( x+dp, y+ry, w+ds, h-ry2 );
+ SET_RCT( x+rx, y+h-ry, w-rx2, ry+ds );
+ XFillRectangles( dpy, hd, gc_brush, rects, 3 );
+#undef SET_RCT
+ }
+ if ( cpen.style() != NoPen ) { // draw outline
+#define SET_ARC(px, py, w, h, a1, a2) \
+ a->x=px; a->y=py; a->width=w; a->height=h; a->angle1=a1; a->angle2=a2; a++
+ XArc arcs[4];
+ XArc *a = arcs;
+ SET_ARC( x+w-rx2, y, rx2, ry2, 0, 90*64 );
+ SET_ARC( x, y, rx2, ry2, 90*64, 90*64 );
+ SET_ARC( x, y+h-ry2, rx2, ry2, 180*64, 90*64 );
+ SET_ARC( x+w-rx2, y+h-ry2, rx2, ry2, 270*64, 90*64 );
+ XDrawArcs( dpy, hd, gc, arcs, 4 );
+#undef SET_ARC
+#define SET_SEG(xp1, yp1, xp2, yp2) \
+ s->x1=xp1; s->y1=yp1; s->x2=xp2; s->y2=yp2; s++
+ XSegment segs[4];
+ XSegment *s = segs;
+ SET_SEG( x+rx, y, x+w-rx, y );
+ SET_SEG( x+rx, y+h, x+w-rx, y+h );
+ SET_SEG( x, y+ry, x, y+h-ry );
+ SET_SEG( x+w, y+ry, x+w, y+h-ry );
+ XDrawSegments( dpy, hd, gc, segs, 4 );
+#undef SET_SET
+ }
+}
+
+/*!
+ Draws an ellipse with center at \a (x + w/2, y + h/2) and size \a
+ (w, h).
+*/
+
+void TQPainter::drawEllipse( int x, int y, int w, int h )
+{
+ if ( !isActive() )
+ return;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ TQRect r( x, y, w, h );
+ param[0].rect = &r;
+ if ( !pdev->cmd( TQPaintDevice::PdcDrawEllipse, this, param ) ||
+ !hd )
+ return;
+ }
+ if ( txop == TxRotShear ) { // rotate/shear polygon
+ TQPointArray a;
+ a.makeArc( x, y, w, h, 0, 360*16, xmat );
+ drawPolyInternal( a );
+ return;
+ }
+ map( x, y, w, h, &x, &y, &w, &h );
+ }
+ if ( w <= 0 || h <= 0 ) {
+ if ( w == 0 || h == 0 )
+ return;
+ fix_neg_rect( &x, &y, &w, &h );
+ }
+ if ( w == 1 && h == 1 ) {
+ XDrawPoint( dpy, hd, (cpen.style() == NoPen)?gc_brush:gc, x, y );
+ return;
+ }
+ w--;
+ h--;
+ if ( cbrush.style() != NoBrush ) { // draw filled ellipse
+ XFillArc( dpy, hd, gc_brush, x, y, w, h, 0, 360*64 );
+ if ( cpen.style() == NoPen ) {
+ XDrawArc( dpy, hd, gc_brush, x, y, w, h, 0, 360*64 );
+ return;
+ }
+ }
+ if ( cpen.style() != NoPen ) // draw outline
+ XDrawArc( dpy, hd, gc, x, y, w, h, 0, 360*64 );
+}
+
+
+/*!
+ Draws an arc defined by the rectangle \a (x, y, w, h), the start
+ angle \a a and the arc length \a alen.
+
+ The angles \a a and \a alen are 1/16th of a degree, i.e. a full
+ circle equals 5760 (16*360). Positive values of \a a and \a alen
+ mean counter-clockwise while negative values mean the clockwise
+ direction. Zero degrees is at the 3 o'clock position.
+
+ Example:
+ \code
+ TQPainter p( myWidget );
+ p.drawArc( 10,10, 70,100, 100*16, 160*16 ); // draws a "(" arc
+ \endcode
+
+ \sa drawPie(), drawChord()
+*/
+
+void TQPainter::drawArc( int x, int y, int w, int h, int a, int alen )
+{
+ if ( !isActive() )
+ return;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[3];
+ TQRect r( x, y, w, h );
+ param[0].rect = &r;
+ param[1].ival = a;
+ param[2].ival = alen;
+ if ( !pdev->cmd( TQPaintDevice::PdcDrawArc, this, param ) ||
+ !hd )
+ return;
+ }
+ if ( txop == TxRotShear ) { // rotate/shear
+ TQPointArray pa;
+ pa.makeArc( x, y, w, h, a, alen, xmat ); // arc polyline
+ drawPolyInternal( pa, FALSE );
+ return;
+ }
+ map( x, y, w, h, &x, &y, &w, &h );
+ }
+ w--;
+ h--;
+ if ( w <= 0 || h <= 0 ) {
+ if ( w == 0 || h == 0 )
+ return;
+ fix_neg_rect( &x, &y, &w, &h );
+ }
+ if ( cpen.style() != NoPen )
+ XDrawArc( dpy, hd, gc, x, y, w, h, a*4, alen*4 );
+}
+
+
+/*!
+ Draws a pie defined by the rectangle \a (x, y, w, h), the start
+ angle \a a and the arc length \a alen.
+
+ The pie is filled with the current brush().
+
+ The angles \a a and \a alen are 1/16th of a degree, i.e. a full
+ circle equals 5760 (16*360). Positive values of \a a and \a alen
+ mean counter-clockwise while negative values mean the clockwise
+ direction. Zero degrees is at the 3 o'clock position.
+
+ \sa drawArc(), drawChord()
+*/
+
+void TQPainter::drawPie( int x, int y, int w, int h, int a, int alen )
+{
+ // Make sure "a" is 0..360*16, as otherwise a*4 may overflow 16 bits.
+ if ( a > (360*16) ) {
+ a = a % (360*16);
+ } else if ( a < 0 ) {
+ a = a % (360*16);
+ if ( a < 0 ) a += (360*16);
+ }
+
+ if ( !isActive() )
+ return;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[3];
+ TQRect r( x, y, w, h );
+ param[0].rect = &r;
+ param[1].ival = a;
+ param[2].ival = alen;
+ if ( !pdev->cmd( TQPaintDevice::PdcDrawPie, this, param ) || !hd )
+ return;
+ }
+ if ( txop == TxRotShear ) { // rotate/shear
+ TQPointArray pa;
+ pa.makeArc( x, y, w, h, a, alen, xmat ); // arc polyline
+ int n = pa.size();
+ int cx, cy;
+ xmat.map(x+w/2, y+h/2, &cx, &cy);
+ pa.resize( n+2 );
+ pa.setPoint( n, cx, cy ); // add legs
+ pa.setPoint( n+1, pa.at(0) );
+ drawPolyInternal( pa );
+ return;
+ }
+ map( x, y, w, h, &x, &y, &w, &h );
+ }
+ XSetArcMode( dpy, gc_brush, ArcPieSlice );
+ w--;
+ h--;
+ if ( w <= 0 || h <= 0 ) {
+ if ( w == 0 || h == 0 )
+ return;
+ fix_neg_rect( &x, &y, &w, &h );
+ }
+
+ GC g = gc;
+ bool nopen = cpen.style() == NoPen;
+
+ if ( cbrush.style() != NoBrush ) { // draw filled pie
+ XFillArc( dpy, hd, gc_brush, x, y, w, h, a*4, alen*4 );
+ if ( nopen ) {
+ g = gc_brush;
+ nopen = FALSE;
+ }
+ }
+ if ( !nopen ) { // draw pie outline
+ double w2 = 0.5*w; // with, height in ellipsis
+ double h2 = 0.5*h;
+ double xc = (double)x+w2;
+ double yc = (double)y+h2;
+ double ra1 = Q_PI/2880.0*a; // convert a, alen to radians
+ double ra2 = ra1 + Q_PI/2880.0*alen;
+ int xic = qRound(xc);
+ int yic = qRound(yc);
+ XDrawLine( dpy, hd, g, xic, yic,
+ qRound(xc + qcos(ra1)*w2), qRound(yc - qsin(ra1)*h2));
+ XDrawLine( dpy, hd, g, xic, yic,
+ qRound(xc + qcos(ra2)*w2), qRound(yc - qsin(ra2)*h2));
+ XDrawArc( dpy, hd, g, x, y, w, h, a*4, alen*4 );
+ }
+}
+
+
+/*!
+ Draws a chord defined by the rectangle \a (x, y, w, h), the start
+ angle \a a and the arc length \a alen.
+
+ The chord is filled with the current brush().
+
+ The angles \a a and \a alen are 1/16th of a degree, i.e. a full
+ circle equals 5760 (16*360). Positive values of \a a and \a alen
+ mean counter-clockwise while negative values mean the clockwise
+ direction. Zero degrees is at the 3 o'clock position.
+
+ \sa drawArc(), drawPie()
+*/
+
+void TQPainter::drawChord( int x, int y, int w, int h, int a, int alen )
+{
+ if ( !isActive() )
+ return;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[3];
+ TQRect r( x, y, w, h );
+ param[0].rect = &r;
+ param[1].ival = a;
+ param[2].ival = alen;
+ if ( !pdev->cmd(TQPaintDevice::PdcDrawChord, this, param) || !hd )
+ return;
+ }
+ if ( txop == TxRotShear ) { // rotate/shear
+ TQPointArray pa;
+ pa.makeArc( x, y, w-1, h-1, a, alen, xmat ); // arc polygon
+ int n = pa.size();
+ pa.resize( n+1 );
+ pa.setPoint( n, pa.at(0) ); // connect endpoints
+ drawPolyInternal( pa );
+ return;
+ }
+ map( x, y, w, h, &x, &y, &w, &h );
+ }
+ XSetArcMode( dpy, gc_brush, ArcChord );
+ w--;
+ h--;
+ if ( w <= 0 || h <= 0 ) {
+ if ( w == 0 || h == 0 )
+ return;
+ fix_neg_rect( &x, &y, &w, &h );
+ }
+
+ GC g = gc;
+ bool nopen = cpen.style() == NoPen;
+
+ if ( cbrush.style() != NoBrush ) { // draw filled chord
+ XFillArc( dpy, hd, gc_brush, x, y, w, h, a*4, alen*4 );
+ if ( nopen ) {
+ g = gc_brush;
+ nopen = FALSE;
+ }
+ }
+ if ( !nopen ) { // draw chord outline
+ double w2 = 0.5*w; // with, height in ellipsis
+ double h2 = 0.5*h;
+ double xc = (double)x+w2;
+ double yc = (double)y+h2;
+ double ra1 = Q_PI/2880.0*a; // convert a, alen to radians
+ double ra2 = ra1 + Q_PI/2880.0*alen;
+ XDrawLine( dpy, hd, g,
+ qRound(xc + qcos(ra1)*w2), qRound(yc - qsin(ra1)*h2),
+ qRound(xc + qcos(ra2)*w2), qRound(yc - qsin(ra2)*h2));
+ XDrawArc( dpy, hd, g, x, y, w, h, a*4, alen*4 );
+ }
+ XSetArcMode( dpy, gc_brush, ArcPieSlice );
+}
+
+
+/*!
+ Draws \a nlines separate lines from points defined in \a a,
+ starting at \a a[index] (\a index defaults to 0). If \a nlines is
+ -1 (the default) all points until the end of the array are used
+ (i.e. (a.size()-index)/2 lines are drawn).
+
+ Draws the 1st line from \a a[index] to \a a[index+1]. Draws the
+ 2nd line from \a a[index+2] to \a a[index+3] etc.
+
+ \warning On X11, coordinates that do not fit into 16-bit signed
+ values are truncated. This limitation is expected to go away in
+ TQt 4.
+
+ \sa drawPolyline(), drawPolygon(), TQPen
+*/
+
+void TQPainter::drawLineSegments( const TQPointArray &a, int index, int nlines )
+{
+ if ( nlines < 0 )
+ nlines = a.size()/2 - index/2;
+ if ( index + nlines*2 > (int)a.size() )
+ nlines = (a.size() - index)/2;
+ if ( !isActive() || nlines < 1 || index < 0 )
+ return;
+ TQPointArray pa = a;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ if ( 2*nlines != (int)pa.size() ) {
+ pa = TQPointArray( nlines*2 );
+ for ( int i=0; i<nlines*2; i++ )
+ pa.setPoint( i, a.point(index+i) );
+ index = 0;
+ }
+ TQPDevCmdParam param[1];
+ param[0].ptarr = (TQPointArray*)&pa;
+ if ( !pdev->cmd(TQPaintDevice::PdcDrawLineSegments, this, param) ||
+ !hd )
+ return;
+ }
+ if ( txop != TxNone ) {
+ pa = xForm( a, index, nlines*2 );
+ if ( pa.size() != a.size() ) {
+ index = 0;
+ nlines = pa.size()/2;
+ }
+ }
+ }
+ if ( cpen.style() != NoPen )
+ XDrawSegments( dpy, hd, gc,
+ (XSegment*)(pa.shortPoints( index, nlines*2 )), nlines );
+}
+
+
+/*!
+ Draws the polyline defined by the \a npoints points in \a a
+ starting at \a a[index]. (\a index defaults to 0.)
+
+ If \a npoints is -1 (the default) all points until the end of the
+ array are used (i.e. a.size()-index-1 line segments are drawn).
+
+ \warning On X11, coordinates that do not fit into 16-bit signed
+ values are truncated. This limitation is expected to go away in
+ TQt 4.
+
+ \sa drawLineSegments(), drawPolygon(), TQPen
+*/
+
+void TQPainter::drawPolyline( const TQPointArray &a, int index, int npoints )
+{
+ if ( npoints < 0 )
+ npoints = a.size() - index;
+ if ( index + npoints > (int)a.size() )
+ npoints = a.size() - index;
+ if ( !isActive() || npoints < 2 || index < 0 )
+ return;
+ TQPointArray pa = a;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ if ( npoints != (int)pa.size() ) {
+ pa = TQPointArray( npoints );
+ for ( int i=0; i<npoints; i++ )
+ pa.setPoint( i, a.point(index+i) );
+ index = 0;
+ }
+ TQPDevCmdParam param[1];
+ param[0].ptarr = (TQPointArray*)&pa;
+ if ( !pdev->cmd(TQPaintDevice::PdcDrawPolyline, this, param) || !hd )
+ return;
+ }
+ if ( txop != TxNone ) {
+ pa = xForm( pa, index, npoints );
+ if ( pa.size() != a.size() ) {
+ index = 0;
+ npoints = pa.size();
+ }
+ }
+ }
+ if ( cpen.style() != NoPen ) {
+ while(npoints>65535) {
+ XDrawLines( dpy, hd, gc, (XPoint*)(pa.shortPoints( index, 65535 )),
+ 65535, CoordModeOrigin );
+ npoints-=65535;
+ index+=65535;
+ }
+ XDrawLines( dpy, hd, gc, (XPoint*)(pa.shortPoints( index, npoints )),
+ npoints, CoordModeOrigin );
+ }
+}
+
+static int global_polygon_shape = Complex;
+
+/*!
+ Draws the polygon defined by the \a npoints points in \a a
+ starting at \a a[index]. (\a index defaults to 0.)
+
+ If \a npoints is -1 (the default) all points until the end of the
+ array are used (i.e. a.size()-index line segments define the
+ polygon).
+
+ The first point is always connected to the last point.
+
+ The polygon is filled with the current brush(). If \a winding is
+ TRUE, the polygon is filled using the winding fill algorithm. If
+ \a winding is FALSE, the polygon is filled using the even-odd
+ (alternative) fill algorithm.
+
+ \warning On X11, coordinates that do not fit into 16-bit signed
+ values are truncated. This limitation is expected to go away in
+ TQt 4.
+
+ \sa drawLineSegments(), drawPolyline(), TQPen
+*/
+
+void TQPainter::drawPolygon( const TQPointArray &a, bool winding,
+ int index, int npoints )
+{
+ if ( npoints < 0 )
+ npoints = a.size() - index;
+ if ( index + npoints > (int)a.size() )
+ npoints = a.size() - index;
+ if ( !isActive() || npoints < 2 || index < 0 )
+ return;
+ TQPointArray pa = a;
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ if ( npoints != (int)a.size() ) {
+ pa = TQPointArray( npoints );
+ for ( int i=0; i<npoints; i++ )
+ pa.setPoint( i, a.point(index+i) );
+ index = 0;
+ }
+ TQPDevCmdParam param[2];
+ param[0].ptarr = (TQPointArray*)&pa;
+ param[1].ival = winding;
+ if ( !pdev->cmd(TQPaintDevice::PdcDrawPolygon, this, param) || !hd )
+ return;
+ }
+ if ( txop != TxNone ) {
+ pa = xForm( a, index, npoints );
+ if ( pa.size() != a.size() ) {
+ index = 0;
+ npoints = pa.size();
+ }
+ }
+ }
+ if ( winding ) // set to winding fill rule
+ XSetFillRule( dpy, gc_brush, WindingRule );
+
+ if ( pa[index] != pa[index+npoints-1] ){ // close open pointarray
+ pa.detach();
+ pa.resize( index+npoints+1 );
+ pa.setPoint( index+npoints, pa[index] );
+ npoints++;
+ }
+
+ if ( cbrush.style() != NoBrush ) { // draw filled polygon
+ XFillPolygon( dpy, hd, gc_brush,
+ (XPoint*)(pa.shortPoints( index, npoints )),
+ npoints, global_polygon_shape, CoordModeOrigin );
+ }
+ if ( cpen.style() != NoPen ) { // draw outline
+ XDrawLines( dpy, hd, gc, (XPoint*)(pa.shortPoints( index, npoints )),
+ npoints, CoordModeOrigin );
+ }
+ if ( winding ) // set to normal fill rule
+ XSetFillRule( dpy, gc_brush, EvenOddRule );
+}
+
+/*!
+ Draws the convex polygon defined by the \a npoints points in \a pa
+ starting at \a pa[index] (\a index defaults to 0).
+
+ If the supplied polygon is not convex, the results are undefined.
+
+ On some platforms (e.g. X Window), this is faster than
+ drawPolygon().
+
+ \warning On X11, coordinates that do not fit into 16-bit signed
+ values are truncated. This limitation is expected to go away in
+ TQt 4.
+*/
+void TQPainter::drawConvexPolygon( const TQPointArray &pa,
+ int index, int npoints )
+{
+ global_polygon_shape = Convex;
+ drawPolygon(pa, FALSE, index, npoints);
+ global_polygon_shape = Complex;
+}
+
+
+
+/*!
+ Draws a cubic Bezier curve defined by the control points in \a a,
+ starting at \a a[index] (\a index defaults to 0).
+
+ Control points after \a a[index + 3] are ignored. Nothing happens
+ if there aren't enough control points.
+
+ \warning On X11, coordinates that do not fit into 16-bit signed
+ values are truncated. This limitation is expected to go away in
+ TQt 4.
+*/
+
+void TQPainter::drawCubicBezier( const TQPointArray &a, int index )
+{
+ if ( !isActive() )
+ return;
+ if ( a.size() - index < 4 ) {
+#if defined(QT_CHECK_RANGE)
+ qWarning( "TQPainter::drawCubicBezier: Cubic Bezier needs 4 control "
+ "points" );
+#endif
+ return;
+ }
+ TQPointArray pa( a );
+ if ( index != 0 || a.size() > 4 ) {
+ pa = TQPointArray( 4 );
+ for ( int i=0; i<4; i++ )
+ pa.setPoint( i, a.point(index+i) );
+ }
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[1];
+ param[0].ptarr = (TQPointArray*)&pa;
+ if ( !pdev->cmd(TQPaintDevice::PdcDrawCubicBezier, this, param) ||
+ !hd )
+ return;
+ }
+ if ( txop != TxNone )
+ pa = xForm( pa );
+ }
+ if ( cpen.style() != NoPen ) {
+ pa = pa.cubicBezier();
+ XDrawLines( dpy, hd, gc, (XPoint*)pa.shortPoints(), pa.size(),
+ CoordModeOrigin );
+ }
+}
+
+
+/*!
+ Draws a pixmap at \a (x, y) by copying a part of \a pixmap into
+ the paint device.
+
+ \a (x, y) specifies the top-left point in the paint device that is
+ to be drawn onto. \a (sx, sy) specifies the top-left point in \a
+ pixmap that is to be drawn. The default is (0, 0).
+
+ \a (sw, sh) specifies the size of the pixmap that is to be drawn.
+ The default, (-1, -1), means all the way to the bottom right of
+ the pixmap.
+
+ Currently the mask of the pixmap or it's alpha channel are ignored
+ when painting on a TQPrinter.
+
+ \sa bitBlt(), TQPixmap::setMask()
+*/
+
+void TQPainter::drawPixmap( int x, int y, const TQPixmap &pixmap,
+ int sx, int sy, int sw, int sh )
+{
+ if ( !isActive() || pixmap.isNull() )
+ return;
+
+ // right/bottom
+ if ( sw < 0 )
+ sw = pixmap.width() - sx;
+ if ( sh < 0 )
+ sh = pixmap.height() - sy;
+
+ // Sanity-check clipping
+ if ( sx < 0 ) {
+ x -= sx;
+ sw += sx;
+ sx = 0;
+ }
+ if ( sw + sx > pixmap.width() )
+ sw = pixmap.width() - sx;
+ if ( sy < 0 ) {
+ y -= sy;
+ sh += sy;
+ sy = 0;
+ }
+ if ( sh + sy > pixmap.height() )
+ sh = pixmap.height() - sy;
+
+ if ( sw <= 0 || sh <= 0 )
+ return;
+
+ if ( pdev->x11Screen() != pixmap.x11Screen() ) {
+ TQPixmap* p = (TQPixmap*) &pixmap;
+ p->x11SetScreen( pdev->x11Screen() );
+ }
+
+ TQPixmap::x11SetDefaultScreen( pixmap.x11Screen() );
+
+ if ( testf(ExtDev|VxF|WxF) ) {
+ if ( testf(ExtDev) || txop == TxScale || txop == TxRotShear ) {
+ if ( sx != 0 || sy != 0 ||
+ sw != pixmap.width() || sh != pixmap.height() ) {
+ TQPixmap tmp( sw, sh, pixmap.depth() );
+ bitBlt( &tmp, 0, 0, &pixmap, sx, sy, sw, sh, CopyROP, TRUE );
+ if ( pixmap.mask() ) {
+ TQBitmap mask( sw, sh );
+ bitBlt( &mask, 0, 0, pixmap.mask(), sx, sy, sw, sh,
+ CopyROP, TRUE );
+ tmp.setMask( mask );
+ }
+ drawPixmap( x, y, tmp );
+ return;
+ }
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[2];
+ TQRect r(x, y, pixmap.width(), pixmap.height());
+ param[0].rect = &r;
+ param[1].pixmap = &pixmap;
+ if ( !pdev->cmd(TQPaintDevice::PdcDrawPixmap, this, param) || !hd )
+ return;
+ }
+ if ( txop == TxScale || txop == TxRotShear ) {
+ TQWMatrix mat( m11(), m12(),
+ m21(), m22(),
+ dx(), dy() );
+ mat = TQPixmap::trueMatrix( mat, sw, sh );
+ TQPixmap pm = pixmap.xForm( mat );
+ if ( !pm.mask() && txop == TxRotShear ) {
+ TQBitmap bm_clip( sw, sh, 1 );
+ bm_clip.fill( color1 );
+ pm.setMask( bm_clip.xForm(mat) );
+ }
+ map( x, y, &x, &y ); // compute position of pixmap
+ int dx, dy;
+ mat.map( 0, 0, &dx, &dy );
+ uint save_flags = flags;
+ flags = IsActive | (save_flags & ClipOn);
+ drawPixmap( x-dx, y-dy, pm );
+ flags = save_flags;
+ return;
+ }
+ }
+ map( x, y, &x, &y );
+ }
+
+ TQBitmap *mask = (TQBitmap *)pixmap.mask();
+ bool mono = pixmap.depth() == 1;
+
+ if ( mask && !hasClipping() && pdev != paintEventDevice ) {
+ if ( mono ) { // needs GCs pen color
+ bool selfmask = pixmap.data->selfmask;
+ if ( selfmask ) {
+ XSetFillStyle( dpy, gc, FillStippled );
+ XSetStipple( dpy, gc, pixmap.handle() );
+ } else {
+ XSetFillStyle( dpy, gc, FillOpaqueStippled );
+ XSetStipple( dpy, gc, pixmap.handle() );
+ XSetClipMask( dpy, gc, mask->handle() );
+ XSetClipOrigin( dpy, gc, x-sx, y-sy );
+ }
+ XSetTSOrigin( dpy, gc, x-sx, y-sy );
+ XFillRectangle( dpy, hd, gc, x, y, sw, sh );
+ XSetTSOrigin( dpy, gc, 0, 0 );
+ XSetFillStyle( dpy, gc, FillSolid );
+ if ( !selfmask ) {
+ if ( pdev == paintEventDevice && paintEventClipRegion ) {
+ x11SetClipRegion( dpy, gc, 0, rendhd, *paintEventClipRegion );
+ } else {
+ x11ClearClipRegion(dpy, gc, 0, rendhd);
+ }
+ }
+ } else {
+ bitBlt( pdev, x, y, &pixmap, sx, sy, sw, sh, (RasterOp)rop );
+ }
+ return;
+ }
+
+ TQRegion rgn = crgn;
+
+ if ( mask ) { // pixmap has clip mask
+ // Implies that clipping is on, either explicit or implicit
+ // Create a new mask that combines the mask with the clip region
+
+ if ( pdev == paintEventDevice && paintEventClipRegion ) {
+ if ( hasClipping() )
+ rgn = rgn.intersect( *paintEventClipRegion );
+ else
+ rgn = *paintEventClipRegion;
+ }
+
+ TQBitmap *comb = new TQBitmap( sw, sh );
+ comb->detach();
+ GC cgc = qt_xget_temp_gc( pixmap.x11Screen(), TRUE ); // get temporary mono GC
+ XSetForeground( dpy, cgc, 0 );
+ XFillRectangle( dpy, comb->handle(), cgc, 0, 0, sw, sh );
+ XSetBackground( dpy, cgc, 0 );
+ XSetForeground( dpy, cgc, 1 );
+ int num;
+ XRectangle *rects = (XRectangle *)qt_getClipRects( rgn, num );
+ XSetClipRectangles( dpy, cgc, -x, -y, rects, num, YXBanded );
+ XSetFillStyle( dpy, cgc, FillOpaqueStippled );
+ XSetStipple( dpy, cgc, mask->handle() );
+ XSetTSOrigin( dpy, cgc, -sx, -sy );
+ XFillRectangle( dpy, comb->handle(), cgc, 0, 0, sw, sh );
+ XSetTSOrigin( dpy, cgc, 0, 0 ); // restore cgc
+ XSetFillStyle( dpy, cgc, FillSolid );
+ XSetClipMask( dpy, cgc, None );
+ mask = comb; // it's deleted below
+
+ XSetClipMask( dpy, gc, mask->handle() );
+ XSetClipOrigin( dpy, gc, x, y );
+ }
+
+ if ( mono ) {
+ XSetBackground( dpy, gc, bg_col.pixel(scrn) );
+ XSetFillStyle( dpy, gc, FillOpaqueStippled );
+ XSetStipple( dpy, gc, pixmap.handle() );
+ XSetTSOrigin( dpy, gc, x-sx, y-sy );
+ XFillRectangle( dpy, hd, gc, x, y, sw, sh );
+ XSetTSOrigin( dpy, gc, 0, 0 );
+ XSetFillStyle( dpy, gc, FillSolid );
+ } else {
+#if !defined(QT_NO_XFTFREETYPE) && !defined(QT_NO_XRENDER)
+ Picture pict = rendhd ? XftDrawPicture((XftDraw *) rendhd) : None;
+ TQPixmap *alpha = pixmap.data->alphapm;
+
+ if ( pict && pixmap.x11RenderHandle() &&
+ alpha && alpha->x11RenderHandle()) {
+ XRenderComposite(dpy, PictOpOver, pixmap.x11RenderHandle(),
+ alpha->x11RenderHandle(), pict,
+ sx, sy, sx, sy, x, y, sw, sh);
+ } else
+#endif // !QT_NO_XFTFREETYPE && !QT_NO_XRENDER
+ {
+ XCopyArea( dpy, pixmap.handle(), hd, gc, sx, sy, sw, sh, x, y );
+ }
+ }
+
+ if ( mask ) { // restore clipping
+ XSetClipOrigin( dpy, gc, 0, 0 );
+ XSetRegion( dpy, gc, rgn.handle() );
+ delete mask; // delete comb, created above
+ }
+}
+
+
+/* Internal, used by drawTiledPixmap */
+
+static void drawTile( TQPainter *p, int x, int y, int w, int h,
+ const TQPixmap &pixmap, int xOffset, int yOffset )
+{
+ int yPos, xPos, drawH, drawW, yOff, xOff;
+ yPos = y;
+ yOff = yOffset;
+ while( yPos < y + h ) {
+ drawH = pixmap.height() - yOff; // Cropping first row
+ if ( yPos + drawH > y + h ) // Cropping last row
+ drawH = y + h - yPos;
+ xPos = x;
+ xOff = xOffset;
+ while( xPos < x + w ) {
+ drawW = pixmap.width() - xOff; // Cropping first column
+ if ( xPos + drawW > x + w ) // Cropping last column
+ drawW = x + w - xPos;
+ p->drawPixmap( xPos, yPos, pixmap, xOff, yOff, drawW, drawH );
+ xPos += drawW;
+ xOff = 0;
+ }
+ yPos += drawH;
+ yOff = 0;
+ }
+}
+
+#if 0 // see comment in drawTiledPixmap
+/* Internal, used by drawTiledPixmap */
+
+static void fillTile( TQPixmap *tile, const TQPixmap &pixmap )
+{
+ bitBlt( tile, 0, 0, &pixmap, 0, 0, -1, -1, TQt::CopyROP, TRUE );
+ int x = pixmap.width();
+ while ( x < tile->width() ) {
+ bitBlt( tile, x,0, tile, 0,0, x,pixmap.height(), TQt::CopyROP, TRUE );
+ x *= 2;
+ }
+ int y = pixmap.height();
+ while ( y < tile->height() ) {
+ bitBlt( tile, 0,y, tile, 0,0, tile->width(),y, TQt::CopyROP, TRUE );
+ y *= 2;
+ }
+}
+#endif
+
+/*!
+ Draws a tiled \a pixmap in the specified rectangle.
+
+ \a (x, y) specifies the top-left point in the paint device that is
+ to be drawn onto; with the width and height given by \a w and \a
+ h. \a (sx, sy) specifies the top-left point in \a pixmap that is
+ to be drawn. The default is (0, 0).
+
+ Calling drawTiledPixmap() is similar to calling drawPixmap()
+ several times to fill (tile) an area with a pixmap, but is
+ potentially much more efficient depending on the underlying window
+ system.
+
+ \sa drawPixmap()
+*/
+
+void TQPainter::drawTiledPixmap( int x, int y, int w, int h,
+ const TQPixmap &pixmap, int sx, int sy )
+{
+ int sw = pixmap.width();
+ int sh = pixmap.height();
+ if (!sw || !sh )
+ return;
+ if ( sx < 0 )
+ sx = sw - -sx % sw;
+ else
+ sx = sx % sw;
+ if ( sy < 0 )
+ sy = sh - -sy % sh;
+ else
+ sy = sy % sh;
+ /*
+ Retquirements for optimizing tiled pixmaps:
+ - not an external device
+ - not scale or rotshear
+ - not mono pixmap
+ - no mask
+ */
+ TQBitmap *mask = (TQBitmap *)pixmap.mask();
+ if ( !testf(ExtDev) && txop <= TxTranslate && pixmap.depth() > 1 &&
+ mask == 0 ) {
+ if ( txop == TxTranslate )
+ map( x, y, &x, &y );
+
+#if !defined(QT_NO_XFTFREETYPE) && !defined(QT_NO_XRENDER)
+ Picture pict = rendhd ? XftDrawPicture((XftDraw *) rendhd) : None;
+ TQPixmap *alpha = pixmap.data->alphapm;
+
+ if (pict && pixmap.x11RenderHandle() && alpha && alpha->x11RenderHandle()) {
+ // this is essentially drawTile() from above, inlined for
+ // the XRenderComposite call
+ int yPos, xPos, drawH, drawW, yOff, xOff;
+ yPos = y;
+ yOff = sy;
+ while( yPos < y + h ) {
+ drawH = pixmap.height() - yOff; // Cropping first row
+ if ( yPos + drawH > y + h ) // Cropping last row
+ drawH = y + h - yPos;
+ xPos = x;
+ xOff = sx;
+ while( xPos < x + w ) {
+ drawW = pixmap.width() - xOff; // Cropping first column
+ if ( xPos + drawW > x + w ) // Cropping last column
+ drawW = x + w - xPos;
+ XRenderComposite(dpy, PictOpOver, pixmap.x11RenderHandle(),
+ alpha->x11RenderHandle(), pict,
+ xOff, yOff, xOff, yOff, xPos, yPos, drawW, drawH);
+ xPos += drawW;
+ xOff = 0;
+ }
+ yPos += drawH;
+ yOff = 0;
+ }
+ return;
+ }
+#endif // !QT_NO_XFTFREETYPE && !QT_NO_XRENDER
+
+ XSetTile( dpy, gc, pixmap.handle() );
+ XSetFillStyle( dpy, gc, FillTiled );
+ XSetTSOrigin( dpy, gc, x-sx, y-sy );
+ XFillRectangle( dpy, hd, gc, x, y, w, h );
+ XSetTSOrigin( dpy, gc, 0, 0 );
+ XSetFillStyle( dpy, gc, FillSolid );
+ return;
+ }
+
+#if 0
+ // maybe there'll be point in this again, but for the time all it
+ // does is make trouble for the postscript code.
+ if ( sw*sh < 8192 && sw*sh < 16*w*h ) {
+ int tw = sw;
+ int th = sh;
+ while( th * tw < 4096 && ( th < h || tw < w ) ) {
+ if ( h/th > w/tw )
+ th *= 2;
+ else
+ tw *= 2;
+ }
+ TQPixmap tile( tw, th, pixmap.depth(), TQPixmap::NormalOptim );
+ fillTile( &tile, pixmap );
+ if ( mask ) {
+ TQBitmap tilemask( tw, th, TQPixmap::NormalOptim );
+ fillTile( &tilemask, *mask );
+ tile.setMask( tilemask );
+ }
+ drawTile( this, x, y, w, h, tile, sx, sy );
+ } else {
+ drawTile( this, x, y, w, h, pixmap, sx, sy );
+ }
+#else
+ // for now we'll just output the original and let the postscript
+ // code make what it can of it. qpicture will be unhappy.
+ drawTile( this, x, y, w, h, pixmap, sx, sy );
+#endif
+}
+
+#if 0
+//
+// Generate a string that describes a transformed bitmap. This string is used
+// to insert and find bitmaps in the global pixmap cache.
+//
+
+static TQString gen_text_bitmap_key( const TQWMatrix &m, const TQFont &font,
+ const TQString &str, int pos, int len )
+{
+ TQString fk = font.key();
+ int sz = 4*2 + len*2 + fk.length()*2 + sizeof(double)*6;
+ TQByteArray buf(sz);
+ uchar *p = (uchar *)buf.data();
+ *((double*)p)=m.m11(); p+=sizeof(double);
+ *((double*)p)=m.m12(); p+=sizeof(double);
+ *((double*)p)=m.m21(); p+=sizeof(double);
+ *((double*)p)=m.m22(); p+=sizeof(double);
+ *((double*)p)=m.dx(); p+=sizeof(double);
+ *((double*)p)=m.dy(); p+=sizeof(double);
+ TQChar h1( '$' );
+ TQChar h2( 'q' );
+ TQChar h3( 't' );
+ TQChar h4( '$' );
+ *((TQChar*)p)=h1; p+=2;
+ *((TQChar*)p)=h2; p+=2;
+ *((TQChar*)p)=h3; p+=2;
+ *((TQChar*)p)=h4; p+=2;
+ memcpy( (char*)p, (char*)(str.unicode()+pos), len*2 ); p += len*2;
+ memcpy( (char*)p, (char*)fk.unicode(), fk.length()*2 ); p += fk.length()*2;
+ return TQString( (TQChar*)buf.data(), buf.size()/2 );
+}
+
+static TQBitmap *get_text_bitmap( const TQString &key )
+{
+ return (TQBitmap*)TQPixmapCache::find( key );
+}
+
+static void ins_text_bitmap( const TQString &key, TQBitmap *bm )
+{
+ if ( !TQPixmapCache::insert(key, bm) ) // cannot insert pixmap
+ delete bm;
+}
+#endif
+
+void qt_draw_transformed_rect( TQPainter *p, int x, int y, int w, int h, bool fill )
+{
+ XPoint points[5];
+ int xp = x, yp = y;
+ p->map( xp, yp, &xp, &yp );
+ points[0].x = xp;
+ points[0].y = yp;
+ xp = x + w; yp = y;
+ p->map( xp, yp, &xp, &yp );
+ points[1].x = xp;
+ points[1].y = yp;
+ xp = x + w; yp = y + h;
+ p->map( xp, yp, &xp, &yp );
+ points[2].x = xp;
+ points[2].y = yp;
+ xp = x; yp = y + h;
+ p->map( xp, yp, &xp, &yp );
+ points[3].x = xp;
+ points[3].y = yp;
+ points[4] = points[0];
+
+ if ( fill )
+ XFillPolygon( p->dpy, p->hd, p->gc, points, 4, Convex, CoordModeOrigin );
+ else
+ XDrawLines( p->dpy, p->hd, p->gc, points, 5, CoordModeOrigin );
+}
+
+void qt_draw_background( TQPainter *p, int x, int y, int w, int h )
+{
+ if (p->testf(TQPainter::ExtDev)) {
+ if (p->pdev->devType() == TQInternal::Printer)
+ p->fillRect(x, y, w, h, p->bg_col);
+ return;
+ }
+ XSetForeground( p->dpy, p->gc, p->bg_col.pixel(p->scrn) );
+ qt_draw_transformed_rect( p, x, y, w, h, TRUE);
+ XSetForeground( p->dpy, p->gc, p->cpen.color().pixel(p->scrn) );
+}
+
+/*!
+ Draws at most \a len characters of the string \a str at position
+ \a (x, y).
+
+ \a (x, y) is the base line position. Note that the meaning of \a y
+ is not the same for the two drawText() varieties.
+*/
+void TQPainter::drawText( int x, int y, const TQString &str, int len, TQPainter::TextDirection dir )
+{
+ drawText( x, y, str, 0, len, dir );
+}
+
+/*!
+ Draws at most \a len characters starting at position \a pos from the
+ string \a str to position \a (x, y).
+
+ \a (x, y) is the base line position. Note that the meaning of \a y
+ is not the same for the two drawText() varieties.
+*/
+void TQPainter::drawText( int x, int y, const TQString &str, int pos, int len, TQPainter::TextDirection dir )
+{
+ if ( !isActive() )
+ return;
+ if (len < 0)
+ len = str.length() - pos;
+ if ( len <= 0 || pos >= (int)str.length() ) // empty string
+ return;
+ if ( pos + len > (int)str.length() )
+ len = str.length() - pos;
+
+ if ( testf(DirtyFont) ) {
+ updateFont();
+ }
+
+ if ( testf(ExtDev) && pdev->devType() != TQInternal::Printer ) {
+ TQPDevCmdParam param[3];
+ TQPoint p(x, y);
+ TQString string = str.mid( pos, len );
+ param[0].point = &p;
+ param[1].str = &string;
+ param[2].ival = TQFont::Latin;
+ if ( !pdev->cmd(TQPaintDevice::PdcDrawText2, this, param) || !hd )
+ return;
+ }
+
+ bool simple = (dir == TQPainter::Auto) && str.simpleText();
+ // we can't take the complete string here as we would otherwise
+ // get quadratic behaviour when drawing long strings in parts.
+ // we do however need some chars around the part we paint to get arabic shaping correct.
+ // ### maybe possible to remove after cursor restrictions work in TQRT
+ int start;
+ int end;
+ if ( simple ) {
+ start = pos;
+ end = pos+len;
+ } else {
+ start = TQMAX( 0, pos - 8 );
+ end = TQMIN( (int)str.length(), pos + len + 8 );
+ }
+ TQConstString cstr( str.unicode() + start, end - start );
+ pos -= start;
+
+ TQTextEngine engine( cstr.string(), pfont ? pfont->d : cfont.d );
+ TQTextLayout layout( &engine );
+
+ // this is actually what beginLayout does. Inlined here, so we can
+ // avoid the bidi algorithm if we don't need it.
+ engine.itemize( simple ? TQTextEngine::NoBidi|TQTextEngine::SingleLine : TQTextEngine::Full|TQTextEngine::SingleLine );
+ engine.currentItem = 0;
+ engine.firstItemInLine = -1;
+
+ if ( dir != Auto ) {
+ int level = dir == RTL ? 1 : 0;
+ for ( int i = engine.items.size(); i >= 0; i-- )
+ engine.items[i].analysis.bidiLevel = level;
+ }
+
+ if ( !simple ) {
+ layout.setBoundary( pos );
+ layout.setBoundary( pos + len );
+ }
+
+ // small hack to force skipping of unneeded items
+ start = 0;
+ while ( engine.items[start].position < pos )
+ ++start;
+ engine.currentItem = start;
+ layout.beginLine( 0xfffffff );
+ end = start;
+ while ( !layout.atEnd() && layout.currentItem().from() < pos + len ) {
+ layout.addCurrentItem();
+ end++;
+ }
+ TQFontMetrics fm(fontMetrics());
+ int ascent = fm.ascent(), descent = fm.descent();
+ int left, right;
+ layout.endLine( 0, 0, TQt::SingleLine|TQt::AlignLeft, &ascent, &descent, &left, &right );
+
+ // do _not_ call endLayout() here, as it would clean up the shaped items and we would do shaping another time
+ // for painting.
+
+ int textFlags = 0;
+ if ( cfont.d->underline ) textFlags |= TQt::Underline;
+ if ( cfont.d->overline ) textFlags |= TQt::Overline;
+ if ( cfont.d->strikeOut ) textFlags |= TQt::StrikeOut;
+
+ if ( bg_mode == OpaqueMode )
+ qt_draw_background( this, x, y-ascent, right-left, ascent+descent+1);
+
+ for ( int i = start; i < end; i++ ) {
+ TQTextItem ti;
+ ti.item = i;
+ ti.engine = &engine;
+
+ drawTextItem( x, y - ascent, ti, textFlags );
+ }
+ layout.d = 0;
+}
+
+
+/*! \internal
+ Draws the text item \a ti at position \a (x, y ).
+
+ This method ignores the painters background mode and
+ color. drawText and qt_format_text have to do it themselves, as
+ only they know the extents of the complete string.
+
+ It ignores the font set on the painter as the text item has one of its own.
+
+ The underline and strikeout parameters of the text items font are
+ ignored aswell. You'll need to pass in the correct flags to get
+ underlining and strikeout.
+*/
+void TQPainter::drawTextItem( int x, int y, const TQTextItem &ti, int textFlags )
+{
+ if ( testf(ExtDev) ) {
+ TQPDevCmdParam param[2];
+ TQPoint p(x, y);
+ param[0].point = &p;
+ param[1].textItem = &ti;
+ bool retval = pdev->cmd(TQPaintDevice::PdcDrawTextItem, this, param);
+ if ( !retval || !hd )
+ return;
+ }
+
+ TQTextEngine *engine = ti.engine;
+ TQScriptItem *si = &engine->items[ti.item];
+
+ engine->shape( ti.item );
+ TQFontEngine *fe = si->fontEngine;
+ assert( fe != 0 );
+
+ x += si->x;
+ y += si->y;
+
+ fe->draw( this, x, y, engine, si, textFlags );
+}
+
+#if QT_VERSION >= 0x040000
+#error "remove current position and associated methods"
+#endif
+/*!
+ \obsolete
+ Returns the current position of the pen.
+
+ \sa moveTo()
+ */
+TQPoint TQPainter::pos() const
+{
+ return curPt;
+}
generated by cgit v1.2.1 (git 2.18.0) at 2024-12-15 04:14:59 +0000